loading...| Preferred Name |
levomilnacipran |
|
| Synonyms |
C15H22N2O (1S,2R)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB08918 |
|
| AHFScode |
28:16.04.16 |
|
| CASRN |
96847-55-1 |
|
| DBBrand |
fetzima |
|
| DBSalt |
levomilnacipran hydrochloride |
|
| Definition |
Levomilnacipran is a selective serotonin and norepinephrine reuptake inhibitor. Chemically, levomilnacipran is the 1S,2R-enantiomer of milnacipran. FDA approved on July 25, 2013. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C15H22N2O/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12/h5-9,13H,3-4,10-11,16H2,1-2H3/t13-,15+/m0/s1 |
|
| InChIKey |
InChIKey=GJJFMKBJSRMPLA-DZGCQCFKSA-N |
|
| inhibits | ||
| is metabolised by |
http://purl.obolibrary.org/obo/dinto_2993 http://purl.obolibrary.org/obo/dinto_1847 http://purl.obolibrary.org/obo/dinto_0291 |
|
| is transported by | ||
| label |
levomilnacipran |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB08918 |
|
| prefLabel |
levomilnacipran |
|
| SMILES |
CCN(CC)C(=O)[C@]1(C[C@H]1CN)C1=CC=CC=C1 |
|
| Synonym |
C15H22N2O (1S,2R)-2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropane-1-carboxamide |
|
| xref | ||
| subClassOf |