loading...| Preferred Name | aminopterin | |
| Synonyms |
C19H20N8O5 (2S)-2-[(4-{[(2,4-diaminopteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB08878 |
|
| binds | ||
| CASRN |
54-62-6 |
|
| DBSynonym |
aminopterine a-ninopterin 4-amino-4-deoxypteroylglutamate aminopteridine 4'-amino-folsaeure n-(4-{[(2,4-diamino-6-pteridinyl)methyl]amino}benzoyl)glutamic acid pteramina apga 4-aminofolic acid minopterin 4-amino-pga 4-aminopteroylglutamic acid |
|
| Definition |
Aminopterin is an amino derivative of folic acid, which was once used as an antineoplastic agent in the treatment of pediatric leukemia. In the 1950 s its production was discontinued in favor of methotrexate, which is less potent but less toxic. Off label, aminopterin has also been used in the treatment of psoriasis. Clinicians need to be aware of the characteristic teratologic effects of aminopterin and methotrexate. |
|
| InChI |
InChI=1S/C19H20N8O5/c20-15-14-16(27-19(21)26-15)23-8-11(24-14)7-22-10-3-1-9(2-4-10)17(30)25-12(18(31)32)5-6-13(28)29/h1-4,8,12,22H,5-7H2,(H,25,30)(H,28,29)(H,31,32)(H4,20,21,23,26,27)/t12-/m0/s1 |
|
| InChIKey |
InChIKey=TVZGACDUOSZQKY-LBPRGKRZSA-N |
|
| inhibits | ||
| label |
aminopterin |
|
| prefixIRI |
obo2:dinto_DB08878 |
|
| prefLabel |
aminopterin |
|
| related with | ||
| SMILES |
NC1=NC2=C(N=C(CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=N2)C(N)=N1 |
|
| Synonym |
C19H20N8O5 (2S)-2-[(4-{[(2,4-diaminopteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Aminopterin ChEBI:376180 |
|
| subClassOf |