loading...| Preferred Name |
nandrolone decanoate |
|
| Synonyms |
C28H44O3 (1S,2R,10R,11S,14S,15S)-15-methyl-5-oxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-14-yl decanoate |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB08804 |
|
| activates | ||
| AHFScode |
68:08.00 |
|
| ATCCode |
A14AB01 S01XA11 |
|
| CASRN |
360-70-3 |
|
| DBBrand |
retabolil deca durabolin deca-durabol deca-durabolin |
|
| DBSynonym |
nortestosterone decanoate norandrostenolone decanoate |
|
| Definition |
C18 steroid with androgenic and anabolic properties. It is generally prepared from alkyl ethers of estradiol to resemble testosterone but less one carbon at the 19 position. It is a schedule III drug in the U.S. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C28H44O3/c1-3-4-5-6-7-8-9-10-27(30)31-26-16-15-25-24-13-11-20-19-21(29)12-14-22(20)23(24)17-18-28(25,26)2/h19,22-26H,3-18H2,1-2H3/t22-,23+,24+,25-,26-,28-/m0/s1 |
|
| InChIKey |
InChIKey=JKWKMORAXJQQSR-MOPIKTETSA-N |
|
| induces | ||
| inhibits | ||
| label |
nandrolone decanoate |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB08804 |
|
| prefLabel |
nandrolone decanoate |
|
| SMILES |
CCCCCCCCCC(=O)O[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
|
| Synonym |
C28H44O3 (1S,2R,10R,11S,14S,15S)-15-methyl-5-oxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-14-yl decanoate |
|
| xref |
PharmGKB:PA165958423 Wikipedia:http://en.wikipedia.org/wiki/Nandrolone_decanoate Drugs.com:http://www.drugs.com/cdi/nandrolone.html ChemSpider:9296 Drugs Product Database (DPD):270687 |
|
| subClassOf |