loading...| Preferred Name | niclosamide | |
| Synonyms |
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide C13H8Cl2N2O4 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB06803 |
|
| ATCCode |
P02DA01 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_2651 |
|
| blocks | ||
| CASRN |
50-65-7 |
|
| DBBrand |
niclocide |
|
| Definition |
Niclosamide is used for the treatment of most tapeworm infections. Helminths (worms) are multicellular organisms that infect very large numbers of humans and cause a broad range of diseases. Over 1 billion people are infected with intestinal nematodes, and many millions are infected with filarial nematodes, flukes, and tapeworms. They are an even greater problem in domestic animals. |
|
| InChI |
InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
|
| InChIKey |
InChIKey=RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| is substrate of | ||
| label |
niclosamide |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB06803 |
|
| prefLabel |
niclosamide |
|
| SMILES |
OC1=C(C=C(Cl)C=C1)C(=O)NC1=C(Cl)C=C(C=C1)[N+]([O-])=O |
|
| Synonym |
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide C13H8Cl2N2O4 |
|
| xref |
PharmGKB:PA165958408 PubChem Compound:4477 Wikipedia:http://en.wikipedia.org/wiki/Niclosamide PubChem Substance:99443295 ChemSpider:4322 |
|
| subClassOf |