loading...| Preferred Name | chenodeoxycholic acid | |
| Synonyms |
C24H40O4 (4R)-4-[(1S,2S,5R,7S,9R,10R,11S,14R,15R)-5,9-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanoic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB06777 |
|
| ATCCode |
A05AA01 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_1890 http://purl.obolibrary.org/obo/dinto_0339 |
|
| CASRN |
474-25-9 |
|
| DBBrand |
chenodal chenodiol chenix |
|
| DBSynonym |
chenocholic acid chenodesoxycholic acid chenodiol |
|
| Definition |
Chenodeoxycholic acid (or Chenodiol) is an epimer of ursodeoxycholic acid (DB01586). Chenodeoxycholic acid is a bile acid naturally found in the body. It works by dissolving the cholesterol that makes gallstones and inhibiting production of cholesterol in the liver and absorption in the intestines, which helps to decrease the formation of gallstones. It can also reduce the amount of other bile acids that can be harmful to liver cells when levels are elevated. |
|
| InChI |
InChI=1S/C24H40O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-20,22,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16-,17-,18+,19+,20-,22+,23+,24-/m1/s1 |
|
| InChIKey |
InChIKey=RUDATBOHQWOJDD-BSWAIDMHSA-N |
|
| inhibits | ||
| is metabolised by | ||
| is substrate of | ||
| label |
chenodeoxycholic acid |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB06777 |
|
| prefLabel |
chenodeoxycholic acid |
|
| related with | ||
| SMILES |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(O)=O |
|
| Synonym |
C24H40O4 (4R)-4-[(1S,2S,5R,7S,9R,10R,11S,14R,15R)-5,9-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanoic acid |
|
| xref |
PubChem Compound:10133 Drugs.com:http://www.drugs.com/cdi/chenodiol.html National Drug Code Directory:0722-7121-01 ChemSpider:9728 Wikipedia:http://en.wikipedia.org/wiki/Chenodeoxycholic_acid PharmGKB:PA165958403 PubChem Substance:99443291 ChEBI:16755 |
|
| subClassOf |