loading...| Preferred Name | amineptine | |
| Synonyms |
C22H28ClNO2 N-(6-carboxyhexyl)tricyclo[9.4.0.0^{3,8}]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-aminium chloride |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB04836 |
|
| ATCCode |
N06AA19 |
|
| binds | ||
| CASRN |
57574-09-1 |
|
| DBBrand |
maneon survector |
|
| DBSynonym |
amineptine hydrochloride |
|
| Definition |
The Food and Drug Administration suspended the marketing authorisation for Survector in 1999 and France withdrew it from the market, however several developing countries continued to produce it up until 2005. |
|
| InChI |
InChI=1S/C22H27NO2.ClH/c24-21(25)13-3-1-2-8-16-23-22-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)22;/h4-7,9-12,22-23H,1-3,8,13-16H2,(H,24,25);1H |
|
| InChIKey |
InChIKey=VDPUXONTAVMIKZ-UHFFFAOYSA-N |
|
| label |
amineptine |
|
| prefixIRI |
obo2:dinto_DB04836 |
|
| prefLabel |
amineptine |
|
| related with | ||
| SMILES |
[Cl-].OC(=O)CCCCCC[NH2+]C1C2=CC=CC=C2CCC2=CC=CC=C12 |
|
| Synonym |
C22H28ClNO2 N-(6-carboxyhexyl)tricyclo[9.4.0.0^{3,8}]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-aminium chloride |
|
| xref |
PubChem Substance:46509012 ChemSpider:32090 PubChem Compound:34869 Wikipedia:http://en.wikipedia.org/wiki/Amineptine ChEBI:32499 |
|
| subClassOf |