Jump to:
loading...| Preferred Name | biopterin | |
| Synonyms |
C9H11N5O3 2-amino-6-[(1S,2R)-1,2-dihydroxypropyl]-3,4-dihydropteridin-4-one |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB03886 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_2623 |
|
| Definition |
A natural product that has been considered as a growth factor for some insects. [PubChem] |
|
| InChI |
InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17)/t3-,6-/m1/s1 |
|
| InChIKey |
InChIKey=LHQIJBMDNUYRAM-AWFVSMACSA-N |
|
| label |
biopterin |
|
| prefixIRI |
obo2:dinto_DB03886 |
|
| prefLabel |
biopterin |
|
| related with |
http://purl.obolibrary.org/obo/dinto_2623 |
|
| SMILES |
C[C@@H](O)[C@@H](O)C1=CN=C2N=C(N)NC(=O)C2=N1 |
|
| Synonym |
C9H11N5O3 2-amino-6-[(1S,2R)-1,2-dihydroxypropyl]-3,4-dihydropteridin-4-one |
|
| xref |
PDB:BIO PubChem Compound:444475 ChEBI:15373 PubChem Substance:46505723 |
|
| subClassOf |
Create mapping