loading...| Preferred Name | deoxycholic acid | |
| Synonyms |
C24H40O4 (4R)-4-[(1S,2S,5S,7S,10R,11S,14S,15R,16R)-5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanoic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB03619 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_1987 http://purl.obolibrary.org/obo/dinto_1981 |
|
| CASRN |
83-44-3 |
|
| Definition |
A bile acid formed by bacterial action from cholate. It is usually conjugated with glycine or taurine. Deoxycholic acid acts as a detergent to solubilize fats for intestinal absorption, is reabsorbed itself, and is used as a choleretic and detergent. [PubChem] |
|
| InChI |
InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,16+,17+,18+,19+,20+,21-,23+,24-/m1/s1 |
|
| InChIKey |
InChIKey=KXGVEGMKQFWNSR-SYSXUHNUSA-N |
|
| induces | ||
| inhibits | ||
| is substrate of | ||
| is transported by | ||
| label |
deoxycholic acid |
|
| prefixIRI |
obo2:dinto_DB03619 |
|
| prefLabel |
deoxycholic acid |
|
| SMILES |
C[C@H](CCC(O)=O)[C@@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3C[C@@H](O)[C@]12C |
|
| Synonym |
C24H40O4 (4R)-4-[(1S,2S,5S,7S,10R,11S,14S,15R,16R)-5,16-dihydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]pentanoic acid |
|
| xref |
PDB:DHO PubChem Substance:46506360 PubChem Compound:7000965 ChEBI:28834 |
|
| subClassOf |