loading...| Preferred Name | cathine | |
| Synonyms |
C9H13NO (1S,2S)-2-amino-1-phenylpropan-1-ol |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01486 |
|
| ATCCode |
A08AA07 |
|
| CASRN |
492-39-7 |
|
| DBSynonym |
(+)-norpseudoephedrine d-phenylpropanolamine ?-hydroxyamphetamine (1s,2r)-(+)-norephedrine d-cathine pseudonorephedrine norpseudoephedrine (+)-norephedrin d-norephedrine katine |
|
| Definition |
Cathine (?-hydroxyamphetamine) is a monoamine alkaloid found in the shrub Catha edulis (khat). Cathine is a Schedule III drug under the Convention on Psychotropic Substances. In the United States, it is classified as a Schedule IV controlled substance. [Wikipedia] |
|
| InChI |
InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m0/s1 |
|
| InChIKey |
InChIKey=DLNKOYKMWOXYQA-IONNQARKSA-N |
|
| label |
cathine |
|
| prefixIRI |
obo2:dinto_DB01486 |
|
| prefLabel |
cathine |
|
| SMILES |
C[C@H](N)[C@@H](O)C1=CC=CC=C1 |
|
| Synonym |
C9H13NO (1S,2S)-2-amino-1-phenylpropan-1-ol |
|
| xref |
ChemSpider:390189 PubChem Substance:46509110 Wikipedia:http://en.wikipedia.org/wiki/Cathine PubChem Compound:441457 |
|
| subClassOf |