loading...| Preferred Name | bismuth subsalicylate | |
| Synonyms |
C7H5BiO4 2-hydroxy-2H,4H-benzo[d]1,3-dioxa-2-bismacyclohexan-4-one |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01294 |
|
| AHFScode |
56:04.00 56:08.00 92:02.00* 84:92.00 52:92.00 |
|
| ATCCode |
A02BX12 A02BA07 A02BX05 |
|
| binds | ||
| CASRN |
14882-18-9 |
|
| DBBrand |
vismut pepto-bismol extra-strength bismuth stabisol bismed bismuth caplets spiromak forte maalox multi action bismuth chewables wismutsubsalicylat extra strength bismuth bismatrol pms-bismuth subsalicylate |
|
| DBSynonym |
bismuth(iii) subsalicylate bismuthi subsalicylas bismuth bismuth oxide salicylate bismutum subsalicylicum bismuth oxysalicylate |
|
| Definition |
Bismuth subsalicylate is the active ingredient in the popular medication Pepto-Bismol that is used to treat nausea, heartburn, indigestion, upset stomach, diarrhea, and other temporary discomforts of the stomach and gastrointestinal tract. It is also the main ingredient of Kaopectate. It displays anti-inflammatory action (due to salicylic acid) and also acts as an antacid and mild antibiotic. |
|
| InChI |
InChI=1S/C7H6O3.Bi.H2O/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);;1H2/q;+3;/p-3 |
|
| InChIKey |
InChIKey=ZREIPSZUJIFJNP-UHFFFAOYSA-K |
|
| label |
bismuth subsalicylate |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_37924 http://purl.obolibrary.org/obo/CHEBI_5441 http://purl.obolibrary.org/obo/CHEBI_44185 http://purl.obolibrary.org/obo/CHEBI_40050 http://purl.obolibrary.org/obo/CHEBI_3077 http://purl.obolibrary.org/obo/CHEBI_8382 http://purl.obolibrary.org/obo/CHEBI_17650 http://purl.obolibrary.org/obo/CHEBI_27690 http://purl.obolibrary.org/obo/CHEBI_50885 http://purl.obolibrary.org/obo/CHEBI_27902 http://purl.obolibrary.org/obo/dinto_DB00703 http://purl.obolibrary.org/obo/CHEBI_8378 http://purl.obolibrary.org/obo/CHEBI_8426 http://purl.obolibrary.org/obo/CHEBI_71418 |
|
| prefixIRI |
obo2:dinto_DB01294 |
|
| prefLabel |
bismuth subsalicylate |
|
| related with | ||
| SMILES |
O[Bi]1OC(=O)C2=CC=CC=C2O1 |
|
| Synonym |
C7H5BiO4 2-hydroxy-2H,4H-benzo[d]1,3-dioxa-2-bismacyclohexan-4-one |
|
| xref |
Drugs Product Database (DPD):2262363 ChEBI:261649 RxList:http://www.rxlist.com/cgi/generic/pylera.htm ChemSpider:17615374 PubChem Compound:16682734 PharmGKB:PA164774805 PubChem Substance:46507128 Wikipedia:http://en.wikipedia.org/wiki/Bismuth_subsalicylate Drugs.com:http://www.drugs.com/cdi/bismuth-subsalicylate.html |
|
| subClassOf |