loading...| Preferred Name | ridogrel | |
| Synonyms |
5-{[(E)-{pyridin-3-yl[3-(trifluoromethyl)phenyl]methylidene}amino]oxy}pentanoic acid C18H17F3N2O3 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01207 |
|
| binds | ||
| blocks | ||
| CASRN |
110140-89-1 |
|
| DBSynonym |
ridogrelum [inn-latin] |
|
| Definition |
Ridogrel is a dual action drug useful for the prevention of systemic thrombo-embolism and as an adjunctive agent to thrombolytic therapy in acute myocardial infarction. However, there currently are no clinical indications for preferential use of ridogrel over aspirin. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C18H17F3N2O3/c19-18(20,21)15-7-3-5-13(11-15)17(14-6-4-9-22-12-14)23-26-10-2-1-8-16(24)25/h3-7,9,11-12H,1-2,8,10H2,(H,24,25)/b23-17+ |
|
| InChIKey |
InChIKey=GLLPUTYLZIKEGF-HAVVHWLPSA-N |
|
| inhibits | ||
| label |
ridogrel |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB01207 |
|
| prefLabel |
ridogrel |
|
| SMILES |
OC(=O)CCCCO\N=C(\C1=CN=CC=C1)C1=CC(=CC=C1)C(F)(F)F |
|
| Synonym |
5-{[(E)-{pyridin-3-yl[3-(trifluoromethyl)phenyl]methylidene}amino]oxy}pentanoic acid C18H17F3N2O3 |
|
| xref |
BindingDB:50003795 PubChem Compound:5362391 PubChem Substance:46506774 PharmGKB:PA164746413 ChemSpider:4515025 |
|
| subClassOf |