loading...| Preferred Name | oxymorphone | |
| Synonyms |
C17H19NO4 (1S,5R,13R,17S)-10,17-dihydroxy-4-methyl-12-oxa-4-azapentacyclo[9.6.1.0^{1,13}.0^{5,17}.0^{7,18}]octadeca-7(18),8,10-trien-14-one |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01192 |
|
| activates | ||
| binds |
http://purl.obolibrary.org/obo/dinto_2787 http://purl.obolibrary.org/obo/dinto_0760 |
|
| blocks | ||
| CASRN |
76-41-5 |
|
| DBBrand |
opana numorphan opana er |
|
| DBSynonym |
dihydrohydroxymorphinone en3202 14-hydroxydihydromorphinone oximorphonum oxymorphine dihydroxymorphinone |
|
| Definition |
An opioid analgesic with actions and uses similar to those of morphine, apart from an absence of cough suppressant activity. It is used in the treatment of moderate to severe pain, including pain in obstetrics. It may also be used as an adjunct to anesthesia. (From Martindale, The Extra Pharmacopoeia, 30th ed, p1092) |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C17H19NO4/c1-18-7-6-16-13-9-2-3-10(19)14(13)22-15(16)11(20)4-5-17(16,21)12(18)8-9/h2-3,12,15,19,21H,4-8H2,1H3/t12-,15+,16+,17-/m1/s1 |
|
| InChIKey |
InChIKey=UQCNKQCJZOAFTQ-ISWURRPUSA-N |
|
| is metabolised by | ||
| is substrate of | ||
| label |
oxymorphone |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_3699 |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB01192 |
|
| prefLabel |
oxymorphone |
|
| SMILES |
[H][C@@]12OC3=C(O)C=CC4=C3[C@@]11CCN(C)[C@]([H])(C4)[C@]1(O)CCC2=O |
|
| Synonym |
C17H19NO4 (1S,5R,13R,17S)-10,17-dihydroxy-4-methyl-12-oxa-4-azapentacyclo[9.6.1.0^{1,13}.0^{5,17}.0^{7,18}]octadeca-7(18),8,10-trien-14-one |
|
| xref |
RxList:http://www.rxlist.com/cgi/generic2/oxymorphone.htm Wikipedia:http://en.wikipedia.org/wiki/Oxymorphone Drugs Product Database (DPD):1916505 National Drug Code Directory:63481-612-70 Drugs.com:http://www.drugs.com/cdi/oxymorphone.html PubChem Compound:5284604 ChemSpider:4447650 PharmGKB:PA450748 BindingDB:50001707 PubChem Substance:46505296 |
|
| subClassOf |