loading...| Preferred Name |
thiamylal |
|
| Synonyms |
C12H18N2O2S 5-(pentan-2-yl)-5-(prop-2-en-1-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01154 |
|
| activates | ||
| CASRN |
77-27-0 |
|
| DBBrand |
thioseconal surital |
|
| Definition |
A barbiturate that is administered intravenously for the production of complete anesthesia of short duration, for the induction of general anesthesia, or for inducing a hypnotic state. (From Martindale, The Extra Pharmacopoeia, 30th ed, p919) |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_2875 |
|
| InChI |
InChI=1S/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17) |
|
| InChIKey |
InChIKey=XLOMZPUITCYLMJ-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| label |
thiamylal |
|
| prefixIRI |
obo2:dinto_DB01154 |
|
| prefLabel |
thiamylal |
|
| SMILES |
CCCC(C)C1(CC=C)C(=O)NC(=S)NC1=O |
|
| Synonym |
C12H18N2O2S 5-(pentan-2-yl)-5-(prop-2-en-1-yl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|
| xref |
Drugs Product Database (DPD):620823 ChEBI:9536 PharmGKB:PA164746997 PubChem Substance:46506261 ChemSpider:2297298 PubChem Compound:3032285 Wikipedia:http://en.wikipedia.org/wiki/Thiamylal |
|
| subClassOf |