loading...| Preferred Name |
sertaconazole |
|
| Synonyms |
C20H15Cl3N2OS 1-{2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01153 |
|
| ATCCode |
D01AC14 |
|
| binds | ||
| CASRN |
99592-32-2 |
|
| DBBrand |
ertaczo |
|
| DBSynonym |
sertaconazolum [latin] sertaconazol [spanish] |
|
| Definition |
Sertaconazole nitrate is an antifungal medication of the imidazole class. It is available as a cream to treat skin infections such as athlete s foot. [Wikipedia] |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000373 http://purl.obolibrary.org/obo/OAE_0001397 http://purl.obolibrary.org/obo/OAE_0000687 http://purl.obolibrary.org/obo/OAE_0000086 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C20H15Cl3N2OS/c21-14-4-5-16(18(23)8-14)19(9-25-7-6-24-12-25)26-10-13-11-27-20-15(13)2-1-3-17(20)22/h1-8,11-12,19H,9-10H2 |
|
| InChIKey |
InChIKey=JLGKQTAYUIMGRK-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
sertaconazole |
|
| prefixIRI |
obo2:dinto_DB01153 |
|
| prefLabel |
sertaconazole |
|
| SMILES |
ClC1=CC(Cl)=C(C=C1)C(CN1C=CN=C1)OCC1=CSC2=C1C=CC=C2Cl |
|
| Synonym |
C20H15Cl3N2OS 1-{2-[(7-chloro-1-benzothiophen-3-yl)methoxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole |
|
| xref |
PharmGKB:PA164748328 PubChem Substance:46507290 Wikipedia:http://en.wikipedia.org/wiki/Sertaconazole National Drug Code Directory:0062-1650-03 Drugs.com:http://www.drugs.com/cdi/sertaconazole.html RxList:http://www.rxlist.com/cgi/generic/ertaczo.htm ChemSpider:59273 PubChem Compound:65863 |
|
| subClassOf |