loading...| Preferred Name |
prednicarbate |
|
| Synonyms |
2-{14-[(ethoxycarbonyl)oxy]-17-hydroxy-2,15-dimethyl-5-oxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-3,6-dien-14-yl}-2-oxoethyl propanoate C27H36O8 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01130 |
|
| activates | ||
| AHFScode |
84:06.00 92:04.00* |
|
| ATCCode |
V01AA03 V01AA07 D07AC18 |
|
| binds | ||
| CASRN |
73771-04-7 |
|
| DBBrand |
dermatop e emollient dermatop |
|
| Definition |
Prednicarbate is a relatively new topical corticosteroid drug. It is similar in potency to hydrocortisone. It is used in the treatment of inflammatory skin diseases, such as atopic dermatitis. It has a favorable benefit-risk ratio, with an inflammatory action similar to that of a medium potency corticosteroid, but with a low potential to cause skin atrophy. The anti-inflammation action of corticosteroids is associated with the inhibition of the interleukin 1-alpha cytokine within keratinocytes. IL-1a is also found in fibroblasts, where it is responsible for proliferation, collagenase induction and IL-6 synthesis, which are related to skin thickness. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000376 http://purl.obolibrary.org/obo/OAE_0000489 http://purl.obolibrary.org/obo/OAE_0000373 http://purl.obolibrary.org/obo/OAE_0000687 http://purl.obolibrary.org/obo/OAE_0000086 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C27H36O8/c1-5-22(31)34-15-21(30)27(35-24(32)33-6-2)12-10-19-18-8-7-16-13-17(28)9-11-25(16,3)23(18)20(29)14-26(19,27)4/h9,11,13,18-20,23,29H,5-8,10,12,14-15H2,1-4H3 |
|
| InChIKey |
InChIKey=FNPXMHRZILFCKX-UHFFFAOYSA-N |
|
| label |
prednicarbate |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB01130 |
|
| prefLabel |
prednicarbate |
|
| SMILES |
CCOC(=O)OC1(CCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C)C(=O)COC(=O)CC |
|
| Synonym |
2-{14-[(ethoxycarbonyl)oxy]-17-hydroxy-2,15-dimethyl-5-oxotetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadeca-3,6-dien-14-yl}-2-oxoethyl propanoate C27H36O8 |
|
| xref |
RxList:http://www.rxlist.com/cgi/generic2/prednicarbate.htm National Drug Code Directory:0066-0507-15 Drugs Product Database (DPD):2230642 PubChem Compound:52421 PharmGKB:PA164749394 PubChem Substance:46506799 Drugs.com:http://www.drugs.com/cdi/prednicarbate-cream.html Wikipedia:http://en.wikipedia.org/wiki/Prednicarbate ChemSpider:47402 |
|
| subClassOf |