loading...| Preferred Name | oxamniquine | |
| Synonyms |
(7-nitro-2-{[(propan-2-yl)amino]methyl}-1,2,3,4-tetrahydroquinolin-6-yl)methanol C14H21N3O3 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01096 |
|
| ATCCode |
P02BA02 |
|
| binds | ||
| CASRN |
21738-42-1 |
|
| DBBrand |
vansil mansil |
|
| Definition |
An anthelmintic with schistosomicidal activity against Schistosoma mansoni, but not against other Schistosoma spp. Oxamniquine causes worms to shift from the mesenteric veins to the liver where the male worms are retained; the female worms return to the mesentery, but can no longer release eggs. (From Martidale, The Extra Pharmacopoeia, 31st ed, p121) |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3 |
|
| InChIKey |
InChIKey=XCGYUJZMCCFSRP-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
oxamniquine |
|
| prefixIRI |
obo2:dinto_DB01096 |
|
| prefLabel |
oxamniquine |
|
| related with | ||
| SMILES |
CC(C)NCC1CCC2=CC(CO)=C(C=C2N1)[N+]([O-])=O |
|
| Synonym |
(7-nitro-2-{[(propan-2-yl)amino]methyl}-1,2,3,4-tetrahydroquinolin-6-yl)methanol C14H21N3O3 |
|
| xref |
PharmGKB:PA164748782 Drugs.com:http://www.drugs.com/mtm/oxamniquine.html ChemSpider:4451 PubChem Substance:46508789 PubChem Compound:4612 Wikipedia:http://en.wikipedia.org/wiki/Oxamniquine |
|
| subClassOf |