loading...| Preferred Name | mequitazine | |
| Synonyms |
C20H22N2S 10-{1-azabicyclo[2.2.2]octan-3-ylmethyl}-10H-phenothiazine |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01071 |
|
| ATCCode |
R06AD07 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_0901 |
|
| blocks | ||
| CASRN |
29216-28-2 |
|
| DBBrand |
primalan kitazemin mircol zesulan instotal virginan butix metaplexan vigigan |
|
| DBSynonym |
mequitazina [inn-spanish] mequitazinum [inn-latin] mequitazina [spanish] |
|
| Definition |
Mequitazine is a histamine H1 antagonist (antihistamine). It competes with histamine for the normal H1-receptor sites on effector cells of the gastrointestinal tract, blood vessels and respiratory tract. It provides effective, temporary relief of sneezing, watery and itchy eyes, and runny nose due to hay fever and other upper respiratory allergies. |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C20H22N2S/c1-3-7-19-17(5-1)22(18-6-2-4-8-20(18)23-19)14-16-13-21-11-9-15(16)10-12-21/h1-8,15-16H,9-14H2 |
|
| InChIKey |
InChIKey=HOKDBMAJZXIPGC-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| is substrate of | ||
| label |
mequitazine |
|
| modulates | ||
| prefixIRI |
obo2:dinto_DB01071 |
|
| prefLabel |
mequitazine |
|
| SMILES |
C(C1CN2CCC1CC2)N1C2=CC=CC=C2SC2=CC=CC=C12 |
|
| Synonym |
C20H22N2S 10-{1-azabicyclo[2.2.2]octan-3-ylmethyl}-10H-phenothiazine |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Mequitazine PubChem Substance:46505779 PubChem Compound:4066 PharmGKB:PA164748010 ChemSpider:3926 |
|
| subClassOf |