loading...| Preferred Name |
pemirolast |
|
| Synonyms |
C10H8N6O 9-methyl-3-(2H-1,2,3,4-tetrazol-5-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00885 |
|
| CASRN |
100299-08-9 |
|
| DBBrand |
alamast |
|
| DBSynonym |
pemirolast potassium pemirolastum [inn-latin] pemiroplast potassium |
|
| Definition |
Pemirolast potassium is a slightly yellow powder that is soluble in water. It is a mast cell stabilizer that acts as an antiallergic agent. As an ophthalmic aqueous sterile solution, pemirolast is used for the prevention of itching of the eyes caused by allergies such as hay fever, and allergic conjunctivitis. Pemirolast is potentially useful for prophylaxis of pulmonary hypersensitivity reactions to drugs such as paclitaxel. |
|
| InChI |
InChI=1S/C10H8N6O/c1-6-3-2-4-16-9(6)11-5-7(10(16)17)8-12-14-15-13-8/h2-5H,1H3,(H,12,13,14,15) |
|
| InChIKey |
InChIKey=HIANJWSAHKJQTH-UHFFFAOYSA-N |
|
| label |
pemirolast |
|
| prefixIRI |
obo2:dinto_DB00885 |
|
| prefLabel |
pemirolast |
|
| SMILES |
CC1=CC=CN2C(=O)C(=CN=C12)C1=NNN=N1 |
|
| Synonym |
C10H8N6O 9-methyl-3-(2H-1,2,3,4-tetrazol-5-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
|
| xref |
PubChem Substance:46509034 PharmGKB:PA164781018 National Drug Code Directory:68669-711-10 Drugs.com:http://www.drugs.com/cdi/pemirolast.html ChemSpider:51990 RxList:http://www.rxlist.com/cgi/generic/alamast.htm PubChem Compound:57697 |
|
| subClassOf |