loading...| Preferred Name |
meclizine |
|
| Synonyms |
C25H27ClN2 1-[(4-chlorophenyl)(phenyl)methyl]-4-[(3-methylphenyl)methyl]piperazine |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00737 |
|
| AHFScode |
56:22.08 |
|
| ATCCode |
R06AE05 |
|
| blocks | ||
| CASRN |
569-65-3 |
|
| DBBrand |
histametizine postafene navicalm vomissels neo-suprimel dramamine itinerol siguran marex antivert/25 histamethizine meclicot bonine bonamine subari travelon sea-legs ancolon bonadettes histamethine peremesin veritab sabari ancolan medivert vomisseis dramamine ii meclozine monamine meclizine hcl suprimal ravelon parachloramine antivert calmonal neo-istafene histametizyne chiclida neo-suprimal antivert/50 diadril |
|
| Definition |
A histamine H1 antagonist used in the treatment of motion sickness, vertigo, and nausea during pregnancy and radiation sickness. [PubChem] |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000377 http://purl.obolibrary.org/obo/OAE_0001509 http://purl.obolibrary.org/obo/OAE_0000454 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C25H27ClN2/c1-20-6-5-7-21(18-20)19-27-14-16-28(17-15-27)25(22-8-3-2-4-9-22)23-10-12-24(26)13-11-23/h2-13,18,25H,14-17,19H2,1H3 |
|
| InChIKey |
InChIKey=OCJYIGYOJCODJL-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
meclizine |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_42944 http://purl.obolibrary.org/obo/dinto_DB00209 http://purl.obolibrary.org/obo/CHEBI_8874 http://purl.obolibrary.org/obo/CHEBI_53289 http://purl.obolibrary.org/obo/dinto_DB00427 |
|
| prefixIRI |
obo2:dinto_DB00737 |
|
| prefLabel |
meclizine |
|
| SMILES |
CC1=CC(CN2CCN(CC2)C(C2=CC=CC=C2)C2=CC=C(Cl)C=C2)=CC=C1 |
|
| Synonym |
C25H27ClN2 1-[(4-chlorophenyl)(phenyl)methyl]-4-[(3-methylphenyl)methyl]piperazine |
|
| xref |
PubChem Compound:4034 ChemSpider:3894 IUPHAR:2757 PubChem Substance:46507782 RxList:http://www.rxlist.com/cgi/generic/mecliz.htm Drugs.com:http://www.drugs.com/meclizine.html Drugs Product Database (DPD):220442 National Drug Code Directory:0662-2100-66 Guide To Pharmacology:2757 Wikipedia:http://en.wikipedia.org/wiki/Meclizine PharmGKB:PA450338 |
|
| subClassOf |