loading...| Preferred Name | naftifine | |
| Synonyms |
C21H21N methyl(naphthalen-1-ylmethyl)(3-phenylprop-2-en-1-yl)amine |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00735 |
|
| AHFScode |
84:04.08.04 |
|
| ATCCode |
D01AE22 |
|
| binds | ||
| CASRN |
65472-88-0 |
|
| DBBrand |
naftin naftifine hcl |
|
| Definition |
Naftifine is a synthetic, broad spectrum, antifungal agent and allylamine derivative for the topical treatment of tinea pedis, tinea cruris, and tinea corporis caused by the organisms Trichophyton rubrum, Trichophyton mentagrophytes, Trichophyton tonsurans and Epidermophyton floccosum. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000373 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C21H21N/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20/h2-15H,16-17H2,1H3/b11-8+ |
|
| InChIKey |
InChIKey=OZGNYLLQHRPOBR-DHZHZOJOSA-N |
|
| inhibits | ||
| label |
naftifine |
|
| prefixIRI |
obo2:dinto_DB00735 |
|
| prefLabel |
naftifine |
|
| SMILES |
CN(CC=CC1=CC=CC=C1)CC1=CC=CC2=CC=CC=C12 |
|
| Synonym |
C21H21N methyl(naphthalen-1-ylmethyl)(3-phenylprop-2-en-1-yl)amine |
|
| xref |
Drugs Product Database (DPD):2011255 Drugs.com:http://www.drugs.com/cdi/naftifine-cream.html PubChem Substance:46504777 RxList:http://www.rxlist.com/cgi/generic2/naft.htm Wikipedia:http://en.wikipedia.org/wiki/Naftifine PharmGKB:PA164748617 National Drug Code Directory:0259-4770-40 ChemSpider:66071 PubChem Compound:47641 |
|
| subClassOf |