loading...| Preferred Name | succimer | |
| Synonyms |
2,3-disulfanylbutanedioic acid C4H6O4S2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00566 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_3071 http://purl.obolibrary.org/obo/dinto_3069 |
|
| CASRN |
304-55-2 |
|
| chelates |
http://purl.obolibrary.org/obo/dinto_3071 http://purl.obolibrary.org/obo/dinto_3069 |
|
| DBBrand |
chemet |
|
| DBSynonym |
dmsa dimercaptosuccinic acid |
|
| Definition |
A mercaptodicarboxylic acid used as an antidote to heavy metal poisoning because it forms strong chelates with them. [PubChem] |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_3071 http://purl.obolibrary.org/obo/dinto_3069 |
|
| InChI |
InChI=1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8) |
|
| InChIKey |
InChIKey=ACTRVOBWPAIOHC-UHFFFAOYSA-N |
|
| label |
succimer |
|
| prefixIRI |
obo2:dinto_DB00566 |
|
| prefLabel |
succimer |
|
| SMILES |
OC(=O)C(S)C(S)C(O)=O |
|
| Synonym |
2,3-disulfanylbutanedioic acid C4H6O4S2 |
|
| xref |
PubChem Compound:9354 Wikipedia:http://en.wikipedia.org/wiki/Succimer RxList:http://www.rxlist.com/chemet-drug.htm PubChem Substance:46504680 Drugs.com:http://www.drugs.com/cdi/succimer.html PharmGKB:PA451521 BindingDB:50232640 National Drug Code Directory:17156-525-01 ChemSpider:8988 |
|
| subClassOf |