loading...| Preferred Name |
pentostatin |
|
| Synonyms |
(8R)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H,6H,7H,8H-imidazo[4,5-d][1,3]diazepin-8-ol C11H16N4O4 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00552 |
|
| ATCCode |
L01XX08 |
|
| binds | ||
| CASRN |
53910-25-1 |
|
| DBBrand |
co-vidarabine co-v pd-adi vira a deaminase inhibitor nipent vidarbine covidarabine |
|
| DBSynonym |
2'-dcf deoxycoformycin 2'-dexoycoformycin 2'-deoxycoformycin |
|
| Definition |
A potent inhibitor of adenosine deaminase. The drug is effective in the treatment of many lymphoproliferative malignancies, particularly hairy-cell leukemia. It is also synergistic with some other antineoplastic agents and has immunosuppressive activity. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/t6-,7+,8+,9+/m0/s1 |
|
| InChIKey |
InChIKey=FPVKHBSQESCIEP-JQCXWYLXSA-N |
|
| inhibits | ||
| label |
pentostatin |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_4027 |
|
| prefixIRI |
obo2:dinto_DB00552 |
|
| prefLabel |
pentostatin |
|
| SMILES |
OC[C@H]1O[C@H](C[C@@H]1O)N1C=NC2=C1N=CNC[C@H]2O |
|
| Synonym |
(8R)-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H,6H,7H,8H-imidazo[4,5-d][1,3]diazepin-8-ol C11H16N4O4 |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Pentostatin PharmGKB:PA450863 Drugs Product Database (DPD):2011247 PubChem Compound:439693 ChemSpider:37371 PubChem Substance:46507116 BindingDB:50003603 National Drug Code Directory:0409-0801-01 |
|
| subClassOf |