loading...| Preferred Name |
trimethadione |
|
| Synonyms |
C6H9NO3 trimethyl-1,3-oxazolidine-2,4-dione |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00347 |
|
| ATCCode |
N03AC02 |
|
| CASRN |
127-48-0 |
|
| DBBrand |
tromedone triozanona minoaleuiatin tridione etydion petimalin epidone epidione trioxanona tredione trimetin convexina minoaleviatin absentol petidion troxidone epixal neo-absentol mino-aleviatin ptimal tridilona trimethin tridion tricione trimedone absetil petidon tridone edion pitmal trilidona trimedal petilep convenixa tioxanona |
|
| DBSynonym |
trimetadione trimethdione trimethadion |
|
| Definition |
An anticonvulsant effective in absence seizures, but generally reserved for refractory cases because of its toxicity. (From AMA Drug Evaluations Annual, 1994, p378) |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
|
| InChIKey |
InChIKey=IRYJRGCIQBGHIV-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by |
http://purl.obolibrary.org/obo/dinto_2058 http://purl.obolibrary.org/obo/dinto_0293 http://purl.obolibrary.org/obo/dinto_0291 |
|
| label |
trimethadione |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB00347 |
|
| prefLabel |
trimethadione |
|
| SMILES |
CN1C(=O)OC(C)(C)C1=O |
|
| Synonym |
C6H9NO3 trimethyl-1,3-oxazolidine-2,4-dione |
|
| xref |
ChemSpider:5374 Wikipedia:http://en.wikipedia.org/wiki/Trimethadione PubChem Substance:46504478 BindingDB:50019167 Drugs.com:http://www.drugs.com/mtm/trimethadione.html PharmGKB:PA164744924 PubChem Compound:5576 |
|
| subClassOf |