loading...| Preferred Name |
isoetharine |
|
| Synonyms |
4-{1-hydroxy-2-[(propan-2-yl)amino]butyl}benzene-1,2-diol C13H21NO3 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00221 |
|
| activates | ||
| ATCCode |
R03CC06 R03AC07 |
|
| CASRN |
530-08-5 |
|
| DBBrand |
dey-lute isoetharine isoetharine hcl s/f etyprenaline isoetarin beta-2 bronkometer neoisuprel isoetarine dilabron bronkosol |
|
| DBSynonym |
isoetharine mesylate isoetarinum [inn-latin] isoetharine hcl isoetarina [inn-spanish] |
|
| Definition |
Isoetharine is a selective adrenergic beta-2 agonist used as fast acting bronchodilator for emphysema, bronchitis and asthma. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C13H21NO3/c1-4-10(14-8(2)3)13(17)9-5-6-11(15)12(16)7-9/h5-8,10,13-17H,4H2,1-3H3 |
|
| InChIKey |
InChIKey=HUYWAWARQUIQLE-UHFFFAOYSA-N |
|
| label |
isoetharine |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB00221 |
|
| prefLabel |
isoetharine |
|
| SMILES |
CCC(NC(C)C)C(O)C1=CC(O)=C(O)C=C1 |
|
| Synonym |
4-{1-hydroxy-2-[(propan-2-yl)amino]butyl}benzene-1,2-diol C13H21NO3 |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Isoetharine ChemSpider:3630 PubChem Substance:46505384 PubChem Compound:3762 Drugs.com:http://www.drugs.com/mtm/isoetharine-inhalation.html PharmGKB:PA450103 |
|
| subClassOf |