loading...| Preferred Name | l-isoleucine | |
| Synonyms |
C6H13NO2 (2S,3S)-2-amino-3-methylpentanoic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00167 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_1803 http://purl.obolibrary.org/obo/dinto_4021 http://purl.obolibrary.org/obo/dinto_1480 http://purl.obolibrary.org/obo/dinto_3447 http://purl.obolibrary.org/obo/dinto_0085 |
|
| CASRN |
73-32-5 |
|
| DBSynonym |
(s)-isoleucine erythro-l-isoleucine l-ile (2s,3s)-a-amino-b-methylvaleric acid isoleucine (2s,3s)-2-amino-3-methylpentanoic acid 2-amino-3-methylvaleric acid l-(+)-isoleucine 2s,3s-isoleucine (2s,3s)-a-amino-b-methyl-n-valeric acid (s,s)-isoleucine |
|
| Definition |
An essential branched-chain aliphatic amino acid found in many proteins. It is an isomer of leucine. It is important in hemoglobin synthesis and regulation of blood sugar and energy levels. [PubChem] |
|
| InChI |
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 |
|
| InChIKey |
InChIKey=AGPKZVBTJJNPAG-WHFBIAKZSA-N |
|
| inhibits | ||
| label |
l-isoleucine |
|
| prefixIRI |
obo2:dinto_DB00167 |
|
| prefLabel |
l-isoleucine |
|
| related with |
http://purl.obolibrary.org/obo/dinto_4021 http://purl.obolibrary.org/obo/dinto_1480 http://purl.obolibrary.org/obo/dinto_3447 http://purl.obolibrary.org/obo/dinto_0085 |
|
| SMILES |
CC[C@H](C)[C@H](N)C(O)=O |
|
| Synonym |
C6H13NO2 (2S,3S)-2-amino-3-methylpentanoic acid |
|
| xref |
Guide To Pharmacology:3311 PDB:ILE PubChem Substance:46506864 PharmGKB:PA164750430 PDRhealth:http://www.pdrhealth.com/drug_info/nmdrugprofiles/nutsupdrugs/bra_0042.shtml PubChem Compound:6306 ChEBI:17191 ChemSpider:6067 IUPHAR:3311 |
|
| subClassOf |