Preferred Name |
pyridoxine |
|
Synonyms |
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol C8H11NO3 |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB00165 |
|
AHFScode |
88:08.00 92:02.00* |
|
ATCCode |
A11HA02 |
|
binds | ||
CASRN |
65-23-6 |
|
DBBrand |
beesix hydoxin rodex td tex six t.r. hexermine hexermin pyridox hexobion nestrex alestrol benadon aderoxine hexa-betalin hexavibex gravidox bonasanit pyridipca pydox campoviton 6 becilan |
|
DBSalt |
pyridoxine hydrochloride |
|
DBSynonym |
vitamin b6 pyridoxol |
|
Definition |
Pyridoxine is the 4-methanol form of vitamin B6 and is converted to pyridoxal 5-phosphate in the body. Pyridoxal 5-phosphate is a coenzyme for synthesis of amino acids, neurotransmitters (serotonin, norepinephrine), sphingolipids, aminolevulinic acid. Although pyridoxine and vitamin B6 are still frequently used as synonyms, especially by medical researchers, this practice is erroneous and sometimes misleading. [PubChem] |
|
has pharmacological target | ||
InChI |
InChI=1S/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3 |
|
InChIKey |
InChIKey=LXNHXLLTXMVWPM-UHFFFAOYSA-N |
|
inhibits | ||
label |
pyridoxine |
|
prefixIRI |
obo2:dinto_DB00165 |
|
prefLabel |
pyridoxine |
|
related with | ||
SMILES |
CC1=NC=C(CO)C(CO)=C1O |
|
Synonym |
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol C8H11NO3 |
|
xref |
PubChem Compound:1054 ChemSpider:1025 Wikipedia:http://en.wikipedia.org/wiki/Pyridoxine ChEBI:16709 Drugs.com:http://www.drugs.com/cdi/pyridoxine-vitamin-b6-extended-release-tablets.html PubChem Substance:46508560 PharmGKB:PA451897 PDRhealth:http://www.pdrhealth.com/drug_info/nmdrugprofiles/nutsupdrugs/vit_0215.shtml Drugs Product Database (DPD):2246275 |
|
subClassOf |