loading...| Preferred Name |
l-cystine |
|
| Synonyms |
(2R)-2-amino-3-{[(2R)-2-amino-2-carboxyethyl]disulfanyl}propanoic acid C6H12N2O4S2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00138 |
|
| CASRN |
56-89-3 |
|
| DBSynonym |
cystine acid cysteine disulfide (-)-cystine l-alpha-diamino-beta-dithiolactic acid l-dicysteine |
|
| Definition |
A covalently linked dimeric nonessential amino acid formed by the oxidation of cysteine. Two molecules of cysteine are joined together by a disulfide bridge to form cystine. [PubChem] |
|
| InChI |
InChI=1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1 |
|
| InChIKey |
InChIKey=LEVWYRKDKASIDU-IMJSIDKUSA-N |
|
| inhibits | ||
| label |
l-cystine |
|
| prefixIRI |
obo2:dinto_DB00138 |
|
| prefLabel |
l-cystine |
|
| related with |
http://purl.obolibrary.org/obo/dinto_0893 http://purl.obolibrary.org/obo/dinto_0896 |
|
| SMILES |
N[C@@H](CSSC[C@H](N)C(O)=O)C(O)=O |
|
| Synonym |
(2R)-2-amino-3-{[(2R)-2-amino-2-carboxyethyl]disulfanyl}propanoic acid C6H12N2O4S2 |
|
| xref |
PubChem Compound:67678 ChemSpider:60997 PDRhealth:http://www.pdrhealth.com/drug_info/nmdrugprofiles/nutsupdrugs/lcy_0088.shtml ChEBI:16283 PharmGKB:PA449176 PubChem Substance:46506670 |
|
| subClassOf |