loading...| Preferred Name |
tocainide |
|
| Synonyms |
tocainidum N-(2,6-dimethylphenyl)alaninamide C11H16N2O tocainida 2-amino-N-(2,6-dimethylphenyl)propanamide 2-Amino-N-(2,6-dimethylphenyl)propionamid tocainide 2-Amino-2',6'-propionoxylidide Alanyl-2,6-xylidide |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9611 |
|
| altId |
CHEBI:106722 |
|
| ATCCode |
C01BB03 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_1670 |
|
| CASRN |
41708-72-9 |
|
| DBBrand |
tonocard |
|
| DBname |
tocainide |
|
| DBSynonym |
tocainida [inn-spanish] tocainidum [inn-latin] |
|
| Definition |
An amide-based local anaesthetic in which 2,6-dimethylphenylaniline and isobutyric acid have combined to form the amide bond. |
|
| has pharmacological target | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_38070 |
|
| InChI |
InChI=1S/C11H16N2O/c1-7-5-4-6-8(2)10(7)13-11(14)9(3)12/h4-6,9H,12H2,1-3H3,(H,13,14) |
|
| InChIKey |
InChIKey=BUJAGSGYPOAWEI-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
tocainide |
|
| may interact with | ||
| prefixIRI |
obo2:CHEBI_9611 |
|
| prefLabel |
tocainide |
|
| related with | ||
| SMILES |
CC(N)C(=O)NC1=C(C)C=CC=C1C CC(N)C(=O)Nc1c(C)cccc1C |
|
| Synonym |
tocainidum N-(2,6-dimethylphenyl)alaninamide C11H16N2O tocainida 2-amino-N-(2,6-dimethylphenyl)propanamide 2-Amino-N-(2,6-dimethylphenyl)propionamid tocainide 2-Amino-2',6'-propionoxylidide Alanyl-2,6-xylidide |
|
| xref |
ChEMBL:683520 Drugs.com:http://www.drugs.com/mtm/tocainide.html CASRN:41708-72-9 Drugs Product Database (DPD):598941 Beilstein:2416564 PubChem Compound:38945 PubChem Substance:46505385 DrugBank:DB01056 Wikipedia:Tocainide CiteXplore:9989796 ChEBI:9611 PDRhealth:http://www.pdrhealth.com/drug_info/rxdrugprofiles/drugs/ton1451.shtml RxList:http://www.rxlist.com/cgi/generic3/tocainide.htm BindingDB:50092595 KEGG COMPOUND:C07142 PharmGKB:PA451706 KEGG DRUG:D06172 ChemSpider:35632 Wikipedia:http://en.wikipedia.org/wiki/Tocainide |
|
| subClassOf |