loading...| Preferred Name |
dibenzoylmethane |
|
| Synonyms |
2-Benzoylacetophenone omega-benzoylacetophenone Phenyl phenacyl ketone 1,3-diphenylpropane-1,3-dione C15H12O2 omega-Benzoylacetophenone 1,3-Diphenyl-1,3-propanedione DBM |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_75417 |
|
| Definition |
A beta-diketone that is acetylacetone (acac) in which both methyl groups have been replaced by phenyl groups. It is a minor constituent of the root extract of licorice (Glycyrrhiza glabra) and exhibits antimutagenic and anticancer effects. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
| InChI |
InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
|
| InChIKey |
InChIKey=NZZIMKJIVMHWJC-UHFFFAOYSA-N |
|
| label |
dibenzoylmethane |
|
| prefixIRI |
obo2:CHEBI_75417 |
|
| prefLabel |
dibenzoylmethane |
|
| SMILES |
O=C(CC(=O)c1ccccc1)c1ccccc1 |
|
| Synonym |
2-Benzoylacetophenone omega-benzoylacetophenone Phenyl phenacyl ketone 1,3-diphenylpropane-1,3-dione C15H12O2 omega-Benzoylacetophenone 1,3-Diphenyl-1,3-propanedione DBM |
|
| xref |
CASRN:120-46-7 CiteXplore:21162108 Reaxys:514910 CiteXplore:21523861 CiteXplore:19706764 CiteXplore:12122651 CiteXplore:23586238 Wikipedia:Dibenzoylmethane CiteXplore:21341276 ChEMBL:421183 |
|
| subClassOf |