loading...| Preferred Name | cabozantinib | |
| Synonyms |
XL 184 N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide BMS-907351 C28H24FN3O5 BMS 907351 XL184 XL-184 |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_72317 |
|
| binds |
http://purl.obolibrary.org/obo/dinto_0552 http://purl.obolibrary.org/obo/dinto_2886 http://purl.obolibrary.org/obo/dinto_3788 |
|
| blocks |
http://purl.obolibrary.org/obo/dinto_0552 |
|
| CASRN |
849217-68-1 |
|
| DBBrand |
cometriq |
|
| DBSynonym |
xl-184 cabozantinib s-malate |
|
| Definition |
A dicarboxylic acid diamide that is N-phenyl-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide in which the hydrogen at position 4 on the phenyl ring is substituted by a (6,7-dimethoxyquinolin-4-yl)oxy group. A multi-tyrosine kinase inhibitor, used (as its malate salt) for the treatment of progressive, metastatic, medullary thyroid cancer. Cabozantinib was approved in 2012 and is a non-specific tyrosine kinase inhibitor. It is marketed as COMETRIQ?, which is indicated for the treatment of metastatic medullary thyroid cancer. It s label includes a black box warning of gastrointestinal perforations, fistulas, and hemorrhage. |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_0552 |
|
| has role | ||
| InChI |
InChI=1S/C28H24FN3O5/c1-35-24-15-21-22(16-25(24)36-2)30-14-11-23(21)37-20-9-7-19(8-10-20)32-27(34)28(12-13-28)26(33)31-18-5-3-17(29)4-6-18/h3-11,14-16H,12-13H2,1-2H3,(H,31,33)(H,32,34) |
|
| InChIKey |
InChIKey=ONIQOQHATWINJY-UHFFFAOYSA-N |
|
| is metabolised by | ||
| is substrate of | ||
| label |
cabozantinib |
|
| may interact with | ||
| modulates |
http://purl.obolibrary.org/obo/dinto_0552 |
|
| prefixIRI |
obo2:CHEBI_72317 |
|
| prefLabel |
cabozantinib |
|
| SMILES |
COc1cc2nccc(Oc3ccc(NC(=O)C4(CC4)C(=O)Nc4ccc(F)cc4)cc3)c2cc1OC |
|
| Synonym |
XL 184 N-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N'-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide BMS-907351 C28H24FN3O5 BMS 907351 XL184 XL-184 |
|
| xref |
CiteXplore:22585997 CiteXplore:21314233 CiteXplore:23319797 RxList:http://www.rxlist.com/cometriq-drug.htm CiteXplore:23248244 CiteXplore:23292795 KEGG DRUG:D10062 Patent:WO2012109510 Drugs.com:http://www.drugs.com/mtm/cabozantinib.html ChEMBL:1477987 Wikipedia:http://en.wikipedia.org/wiki/Cabozantinib CiteXplore:23319867 CiteXplore:23319755 CiteXplore:20127563 CiteXplore:23104465 CiteXplore:21862995 CiteXplore:21860001 CiteXplore:23337763 ChEBI:72317 CiteXplore:21606412 CiteXplore:23375349 Wikipedia:Cabozantinib CASRN:849217-68-1 CiteXplore:21613405 CiteXplore:23335077 CiteXplore:21926191 CiteXplore:23169517 CiteXplore:23292257 CiteXplore:21460789 Reaxys:18631644 CiteXplore:22146228 CiteXplore:23337762 |
|
| subClassOf |