loading...| Preferred Name | gabapentin enacarbil | |
| Synonyms |
Horizant {1-[({[1-(isobutyryloxy)ethoxy]carbonyl}amino)methyl]cyclohexyl}acetic acid XP 13512 gabapentin enacarbil gabapentina enacarbilo XP-13512 XP13512 gabapentine enacarbil C16H27NO6 gabapentinum enacarbilum |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_68840 |
|
| binds | ||
| CASRN |
478296-72-9 |
|
| DBBrand |
horizant |
|
| Definition |
Gabapentin enacarbil is marketed under the name Horizant?. It is a prodrug of gabapentin, and indicated in adults for the treatment of Restless Legs Syndrome (RLS) and postherpetic neuralgia (PHN). A carbamate ester that is the N-[1-(isobutyryloxy)ethoxy]carbonyl derivative of [1-(aminomethyl)cyclohexyl]acetic acid. The prodrug for gabapentin, used for treatment of neuropathic pain and restless legs syndrome. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_38215 |
|
| InChI |
InChI=1S/C16H27NO6/c1-11(2)14(20)22-12(3)23-15(21)17-10-16(9-13(18)19)7-5-4-6-8-16/h11-12H,4-10H2,1-3H3,(H,17,21)(H,18,19) |
|
| InChIKey |
InChIKey=TZDUHAJSIBHXDL-UHFFFAOYSA-N |
|
| is substrate of | ||
| is transported by | ||
| label |
gabapentin enacarbil |
|
| may interact with | ||
| prefixIRI |
obo2:CHEBI_68840 |
|
| prefLabel |
gabapentin enacarbil |
|
| SMILES |
CC(C)C(=O)OC(C)OC(=O)NCC1(CCCCC1)CC(O)=O |
|
| Synonym |
Horizant {1-[({[1-(isobutyryloxy)ethoxy]carbonyl}amino)methyl]cyclohexyl}acetic acid XP 13512 gabapentin enacarbil gabapentina enacarbilo XP-13512 XP13512 gabapentine enacarbil C16H27NO6 gabapentinum enacarbilum |
|
| xref |
CiteXplore:21897349 CiteXplore:22664749 CASRN:478296-72-9 Patent:US2007049626 CiteXplore:20200691 CiteXplore:21627766 CiteXplore:21255527 CiteXplore:20511481 CiteXplore:22206794 CiteXplore:21677899 Patent:WO2005037784 CiteXplore:22077768 Patent:WO2010063002 CiteXplore:21611981 Patent:WO2008073257 Reaxys:10188772 CiteXplore:22878573 Wikipedia:http://en.wikipedia.org/wiki/Gabapentin_enacarbil ChEBI:68840 CiteXplore:22570552 RxList:http://www.rxlist.com/horizant-drug.htm CiteXplore:21476956 Patent:US2006229361 CiteXplore:21242741 CiteXplore:22325733 ChEMBL:1151353 Drugs.com:http://www.drugs.com/sfx/gabapentin-enacarbil-side-effects.html CiteXplore:22937989 CiteXplore:22849331 CiteXplore:21179617 Patent:WO2006050514 Patent:WO2005066122 CiteXplore:21527006 CiteXplore:20573085 CiteXplore:20629607 CiteXplore:22036917 CiteXplore:22422817 CiteXplore:22298601 CiteXplore:22851801 Wikipedia:Gabapentin_enacarbil |
|
| subClassOf |