loading...| Preferred Name |
lysergic acid diethylamide |
|
| Synonyms |
D-lysergic acid diethylamide Lysergsaeurediaethylamid LSD 25 (4R,7R)-N,N-diethyl-6-methyl-6,11-diazatetracyclo[7.6.1.0^{2,7}.0^{12,16}]hexadeca-1(16),2,9,12,14-pentaene-4-carboxamide N,N-diethyl-D-lysergamide N,N-diethyllysergamide C20H25N3O N,N-diethyl-(+)-lysergamide Lysergsaeurediethylamid (8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide Lysergide LSD Lysergic acid diethylamide (+)-LSD |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6605 |
|
| CASRN |
50-37-3 |
|
| DBSynonym |
contact lens diethylamid kyseliny lysergove [czech] chocolate chips clearlight heavenly blue acid wedding bells royal blue d-lsd white light lysergamid flats blue star d-lysergic acid dethylamide 9,10-didehydro-n,n-diethyl-6-methylergoline-8b-carboxamide d-lysergic acid n,n-diethylamide orange sunshine n,n-diethyl-d-lysergamide cupcakes cubes lysergidum [inn-latin] pearly gates coffeinum lysergic acid amide domes brown dots sunshine mellow yellow lucy in the sky with diamonds bart simpson lysergic acid diethylamide-25 (+)-lsd d-lsd-25 sugar blue acid beast yellows trippers owsley lsd (+)-lysergic acid diethylamide lysergaure diethylamid cherry top california sunshine blotter acid purple haze big f barrels dextrolysergic acid diethylamide greenies scapes frogs wedges lsd-25 orange wedges spoonies blue cheer the hawk sugar lump microdots strawberry fields window pane tabs lysergamide d-lysergic acid diethylamide mean green orange mushroom paper acid chief blue mist gelatin chips delysid n,n-diethyl-(+)-lysergamide n,n-diethyllysergamide bartman n,n-diethyl-6-methyl-9,10-didehydroergoline-8-carboxamide lysergide ubergluben fifty purple microdot zen ergine |
|
| Definition |
An ergoline alkaloid arising from formal condensation of lysergic acid with diethylamine. Debate continues over the nature and causes of chronic flashbacks. Explanations in terms of LSD physically remaining in the body for months or years after consumption have been discounted by experimental evidence. Some say HPPD is a manifestation of post-traumatic stress disorder, not related to the direct action of LSD on brain chemistry, and varies according to the susceptibility of the individual to the disorder. Many emotionally intense experiences can lead to flashbacks when a person is reminded acutely of the original experience. However, not all published case reports of chronic flashbacks appear to describe an anxious hyper-vigilant state reminiscent of post-traumatic stress disorder. |
|
| has role | ||
| InChI |
InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3/t14-,18-/m1/s1 |
|
| InChIKey |
InChIKey=VAYOSLLFUXYJDT-RDTXWAMCSA-N |
|
| label |
lysergic acid diethylamide |
|
| prefixIRI |
obo2:CHEBI_6605 |
|
| prefLabel |
lysergic acid diethylamide |
|
| SMILES |
[H][C@@]12Cc3c[nH]c4cccc(C1=C[C@H](CN2C)C(=O)N(CC)CC)c34 [H][C@@]12CC3=CNC4=CC=CC(=C34)C1=C[C@H](CN2C)C(=O)N(CC)CC |
|
| Synonym |
D-lysergic acid diethylamide Lysergsaeurediaethylamid LSD 25 (4R,7R)-N,N-diethyl-6-methyl-6,11-diazatetracyclo[7.6.1.0^{2,7}.0^{12,16}]hexadeca-1(16),2,9,12,14-pentaene-4-carboxamide N,N-diethyl-D-lysergamide N,N-diethyllysergamide C20H25N3O N,N-diethyl-(+)-lysergamide Lysergsaeurediethylamid (8R)-9,10-didehydro-N,N-diethyl-6-methylergoline-8-carboxamide Lysergide LSD Lysergic acid diethylamide (+)-LSD |
|
| xref |
KEGG COMPOUND:C07542 PubChem Compound:5761 PubChem Substance:46506397 CASRN:50-37-3 Beilstein:94179 ChEMBL:100601 Patent:US2774763 Drugs Product Database (DPD):683094 Patent:US2736728 ChemSpider:5558 Reaxys:94179 Wikipedia:http://en.wikipedia.org/wiki/Lysergic_acid_diethylamide NIST Chemistry WebBook:50-37-3 BindingDB:21342 Patent:US3141887 IUPHAR:219 Guide To Pharmacology:219 |
|
| subClassOf |