loading...| Preferred Name |
lomefloxacin hydrochloride |
|
| Synonyms |
lomefloxacin HCl C17H20ClF2N3O3 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride (+-)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid monohydrochloride |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_6518 |
|
| Definition |
The hydrochloride salt of lomefloxacin. It is administered by mouth to treat bacterial infections including bronchitis and urinary tract infections. It is also used topically as eye drops for the treatment of bacterial conjunctivitis, and as ear drops for the treatment of otitis externa and otitis media. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_47868 |
|
| InChI |
InChI=1S/C17H19F2N3O3.ClH/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22;/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25);1H |
|
| InChIKey |
InChIKey=KXEBLAPZMOQCKO-UHFFFAOYSA-N |
|
| label |
lomefloxacin hydrochloride |
|
| prefixIRI |
obo2:CHEBI_6518 |
|
| prefLabel |
lomefloxacin hydrochloride |
|
| SMILES |
Cl.CCn1cc(C(O)=O)c(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c12 |
|
| Synonym |
lomefloxacin HCl C17H20ClF2N3O3 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride (+-)-1-ethyl-6,8-difluoro-1,4-dihydro-7-(3-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid monohydrochloride |
|
| xref |
KEGG DRUG:D00873 KEGG COMPOUND:C08053 ChEMBL:657467 Reaxys:7506829 DrugBank:DB00978 CASRN:98079-52-8 |
|
| subClassOf |