loading...| Preferred Name |
diethylpropion hydrochloride |
|
| Synonyms |
2-(diethylamino)-1-phenylpropan-1-one hydrochloride amphepramonum hydrochloride alpha-benzoyltriethylamine hydrochloride DIETHYLPROPION HYDROCHLORIDE diethylpropion HCl N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride amfepramone hydrochloride tenuate amfepramone HCl 2-(diethylamino)propiophenone hydrochloride C13H20ClNO alpha-benzoyltriethylammonium chloride Diethylpropion hydrochloride |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_643703 |
|
| altId |
CHEBI:130909 |
|
| Definition |
The hydrochloride salt of diethylpropion. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as an anoretic in the short term management of obesity. |
|
| has role | ||
| InChI |
InChI=1S/C13H19NO.ClH/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12;/h6-11H,4-5H2,1-3H3;1H |
|
| InChIKey |
InChIKey=ICFXZZFWRWNZMA-UHFFFAOYSA-N |
|
| label |
diethylpropion hydrochloride |
|
| prefixIRI |
obo2:CHEBI_643703 |
|
| prefLabel |
diethylpropion hydrochloride |
|
| SMILES |
[Cl-].CC[NH+](CC)C(C)C(=O)c1ccccc1 |
|
| Synonym |
2-(diethylamino)-1-phenylpropan-1-one hydrochloride amphepramonum hydrochloride alpha-benzoyltriethylamine hydrochloride DIETHYLPROPION HYDROCHLORIDE diethylpropion HCl N,N-diethyl-1-oxo-1-phenylpropan-2-aminium chloride amfepramone hydrochloride tenuate amfepramone HCl 2-(diethylamino)propiophenone hydrochloride C13H20ClNO alpha-benzoyltriethylammonium chloride Diethylpropion hydrochloride |
|
| xref |
NIST Chemistry WebBook:134-80-5 DrugBank:DB00937 CASRN:134-80-5 KEGG DRUG:D03801 Beilstein:3915870 |
|
| subClassOf |