loading...| Preferred Name |
difenoxin hydrochloride |
|
| Synonyms |
C28H29ClN2O2 difenoxin HCl 4-carboxy-1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidinium chloride diphenoxylic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid hydrochloride |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59790 |
|
| Definition |
The hydrochloride salt of difenoxin. It has similar actions and uses to diphenoxylate hydrochloride, being administered for the symptomatic treatment of acute and chronic diarrhoea. In an attempt to discourage abuse (at high doses, difenoxin acts like morphine), preparations usually contain subclinical amounts of atropine sulfate. |
|
| has role | ||
| InChI |
InChI=1S/C28H28N2O2.ClH/c29-22-28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)18-21-30-19-16-27(17-20-30,26(31)32)23-10-4-1-5-11-23;/h1-15H,16-21H2,(H,31,32);1H |
|
| InChIKey |
InChIKey=VMIZTXDGZPTKIK-UHFFFAOYSA-N |
|
| label |
difenoxin hydrochloride |
|
| prefixIRI |
obo2:CHEBI_59790 |
|
| prefLabel |
difenoxin hydrochloride |
|
| SMILES |
[Cl-].OC(=O)C1(CC[NH+](CC1)CCC(C#N)(c1ccccc1)c1ccccc1)c1ccccc1 |
|
| Synonym |
C28H29ClN2O2 difenoxin HCl 4-carboxy-1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidinium chloride diphenoxylic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid hydrochloride 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid hydrochloride |
|
| xref |
CASRN:35607-36-4 ChEMBL:774550 |
|
| subClassOf |