loading...| Preferred Name |
chloroxine |
|
| Synonyms |
5,7-dichloro-8-hydroxyquinoline 5,7-dichloroxine 5,7-dichloroquinolin-8-ol CHQ 5,7-dichloro-8-quinolinol 5,7-dichlor-8-hydroxychinolin C9H5Cl2NO 5,7-dichloro-8-oxyquinoline 5,7-dichlorooxine |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59477 |
|
| CASRN |
773-76-2 |
|
| DBBrand |
chlofucid endiaron capitrol quinolor clofuzid quixalin quesyl |
|
| DBname |
chloroxine |
|
| DBSynonym |
chlorquinol dichloroxin dichlorohydroxyquinoline dikhloroskin chloroxyquinoline dichloroquinolinol |
|
| Definition |
Quinolin-8-ol in which the hydrogens at positions 5 and 7 have been substituted by chlorine. An synthetic antibacterial prepared by chlorination of quinolin-8-ol, it is used for the treatment of dandruff and seborrhoeic dermatitis of the scalp. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_24127 |
|
| InChI |
InChI=1S/C9H5Cl2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
|
| InChIKey |
InChIKey=WDFKMLRRRCGAKS-UHFFFAOYSA-N |
|
| label |
chloroxine |
|
| prefixIRI |
obo2:CHEBI_59477 |
|
| prefLabel |
chloroxine |
|
| SMILES |
OC1=C(Cl)C=C(Cl)C2=C1N=CC=C2 Oc1c(Cl)cc(Cl)c2cccnc12 |
|
| Synonym |
5,7-dichloro-8-hydroxyquinoline 5,7-dichloroxine 5,7-dichloroquinolin-8-ol CHQ 5,7-dichloro-8-quinolinol 5,7-dichlor-8-hydroxychinolin C9H5Cl2NO 5,7-dichloro-8-oxyquinoline 5,7-dichlorooxine |
|
| xref |
KEGG DRUG:D03472 PubChem Substance:46508620 Beilstein:153606 ChEMBL:774547 PharmGKB:PA164754879 National Drug Code Directory:0072-6850-04 CASRN:773-76-2 PubChem Compound:2722 NIST Chemistry WebBook:773-76-2 DrugBank:DB01243 Drugs.com:http://www.drugs.com/cons/chloroxine-topical.html ChemSpider:2621 |
|
| subClassOf |