loading...| Preferred Name |
guanadrel |
|
| Synonyms |
1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel 2-{1,4-dioxaspiro[4.5]decan-2-ylmethyl}guanidine guanadrel guanadrelum C10H19N3O2 |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5555 |
|
| binds | ||
| CASRN |
22195-34-2 |
|
| DBBrand |
hylorel guanadrel |
|
| DBname |
guanadrel sulfate |
|
| DBSynonym |
guanadrelum [inn-latin] |
|
| Definition |
A spiroketal resulting from the formal condensation of the keto group of cyclohexanone with the hydroxy groups of 1-(2,3-dihydroxypropyl)guanidine. A postganglionic adrenergic blocking agent formerly used (generally as the sulfate salt) for the management of hypertension, it has been largely superseded by other drugs less likely to cause orthostatic hypotension (dizzy spells on standing up or stretching). |
|
| has pharmacological target | ||
| has role | ||
| InChI |
InChI=1S/C10H19N3O2/c11-9(12)13-6-8-7-14-10(15-8)4-2-1-3-5-10/h8H,1-7H2,(H4,11,12,13) |
|
| InChIKey |
InChIKey=HPBNRIOWIXYZFK-UHFFFAOYSA-N |
|
| label |
guanadrel |
|
| prefixIRI |
obo2:CHEBI_5555 |
|
| prefLabel |
guanadrel |
|
| related with | ||
| SMILES |
NC(N)=NCC1COC2(CCCCC2)O1 NC(=N)NCC1COC2(CCCCC2)O1 |
|
| Synonym |
1-(1,4-dioxaspiro[4.5]dec-2-ylmethyl)guanidine Guanadrel 2-{1,4-dioxaspiro[4.5]decan-2-ylmethyl}guanidine guanadrel guanadrelum C10H19N3O2 |
|
| xref |
HMDB:HMDB14371 CiteXplore:3896742 PubChem Compound:38521 CiteXplore:6621504 Beilstein:8325419 ChEMBL:223976 Wikipedia:Guanadrel CiteXplore:7206175 KEGG COMPOUND:C07035 Patent:US3547951 ChemSpider:35305 Reaxys:8325419 PubChem Substance:46506457 CASRN:40580-59-4 KEGG DRUG:D08029 PharmGKB:PA164745308 Drugs.com:http://www.drugs.com/mtm/guanadrel.html DrugBank:DB00226 |
|
| subClassOf |