loading...| Preferred Name |
alverine citrate |
|
| Synonyms |
C20H27N.C6H8O7 C26H35NO7 N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate N-Ethyl-3,3'-diphenyldipropylamine citrate |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_53785 |
|
| Definition |
The citrate salt of alverine, resulting from the reaction of equimolar amounts of alvarine and citric acid. An antispasmodic that acts directly on intestinal and uterine smooth muscle, it is used in the treatment of irritable bowel syndrome. |
|
| has role | ||
| InChI |
InChI=1S/C20H27N.C6H8O7/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,11-14H,2,9-10,15-18H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
|
| InChIKey |
InChIKey=RYHCACJBKCOBTJ-UHFFFAOYSA-N |
|
| label |
alverine citrate |
|
| prefixIRI |
obo2:CHEBI_53785 |
|
| prefLabel |
alverine citrate |
|
| SMILES |
OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CCCc1ccccc1)CCCc1ccccc1 |
|
| Synonym |
C20H27N.C6H8O7 C26H35NO7 N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine 2-hydroxypropane-1,2,3-tricarboxylate N-Ethyl-3,3'-diphenyldipropylamine citrate |
|
| xref |
CASRN:5560-59-8 CiteXplore:21698811 KEGG DRUG:D02877 ChEMBL:932478 CiteXplore:19148544 DrugBank:DB01616 CiteXplore:19115153 Patent:CN101838205 CiteXplore:20415841 CiteXplore:12030962 Reaxys:3851428 Beilstein:3851428 CiteXplore:20003095 CiteXplore:17934514 CiteXplore:15259090 CiteXplore:20375645 |
|
| subClassOf |