loading...| Preferred Name |
encainide |
|
| Synonyms |
(+-)-2'-[2-(1-methyl-2-piperidyl)ethyl]-p-anisanilide Encainide (+-)-4-methoxy-N-(2-(2-(1-methyl-2-piperidinyl)ethyl)phenyl)benzamide encainide 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide C22H28N2O2 4-Methoxy-N-{2-[2-(1-methyl-piperidin-2-yl)-ethyl]-phenyl}-benzamide encainida encainidum 4-methoxy-2'-[2-(1-methyl-2-piperidyl)ethyl]benzanilide |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4788 |
|
| altId |
CHEBI:239046 |
|
| ATCCode |
C01BC08 |
|
| CASRN |
66778-36-7 |
|
| DBBrand |
enkaid |
|
| DBname |
encainide |
|
| DBSynonym |
encainide [french] encainida [spanish] encainidum [latin] |
|
| Definition |
4-Methoxy-N-phenylbenzamide in which the hydrogen at the 2 position of the phenyl group is substituted by a 2-(1-methylpiperidin-2-yl)ethyl group. A class Ic antiarrhythmic, the hydrochloride was used for the treatment of severe or life-threatening ventricular arrhythmias, but it was associated with increased death rates in patients who had asymptomatic heart rhythm abnormalities after a recent heart attack and was withdrawn from the market. |
|
| has pharmacological target | ||
| has role | ||
| InChI |
InChI=1S/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
|
| InChIKey |
InChIKey=PJWPNDMDCLXCOM-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| label |
encainide |
|
| may interact with | ||
| prefixIRI |
obo2:CHEBI_4788 |
|
| prefLabel |
encainide |
|
| SMILES |
COC1=CC=C(C=C1)C(=O)NC1=CC=CC=C1CCC1CCCCN1C COc1ccc(cc1)C(=O)Nc1ccccc1CCC1CCCCN1C |
|
| Synonym |
(+-)-2'-[2-(1-methyl-2-piperidyl)ethyl]-p-anisanilide Encainide (+-)-4-methoxy-N-(2-(2-(1-methyl-2-piperidinyl)ethyl)phenyl)benzamide encainide 4-methoxy-N-{2-[2-(1-methylpiperidin-2-yl)ethyl]phenyl}benzamide C22H28N2O2 4-Methoxy-N-{2-[2-(1-methyl-piperidin-2-yl)-ethyl]-phenyl}-benzamide encainida encainidum 4-methoxy-2'-[2-(1-methyl-2-piperidyl)ethyl]benzanilide |
|
| xref |
ChEBI:4788 KEGG COMPOUND:C06978 PharmGKB:PA449459 DrugBank:DB01228 Patent:US3931195 KEGG DRUG:D07894 Patent:DE2210154 Beilstein:497572 CASRN:66778-36-7 National Drug Code Directory:0087-0732-41 Wikipedia:http://en.wikipedia.org/wiki/Encainide |
|
| subClassOf |