loading...| Preferred Name |
carmustine |
|
| Synonyms |
Carmustine 1,3-bis(2-chloroethyl)-1-nitrosourea Gliadel C5H9Cl2N3O2 Bicnu (TN) N,N'-Bis(2-chloroethyl)-N-nitrosourea |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3423 |
|
| AHFScode |
10:00.00 |
|
| ATCCode |
L01AD01 |
|
| CASRN |
154-93-8 |
|
| DBBrand |
bicnu carmubris nitrumon gliadel gliadel wafer becenun bi cnu |
|
| DBname |
carmustine |
|
| DBSynonym |
bischlorethylnitrosourea carmustin bischlorethylnitrosurea bcnu |
|
| Definition |
An urea that has formula C5H9Cl2N3O2. |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_2873 |
|
| has role | ||
| InChI |
InChI=1S/C5H9Cl2N3O2/c6-1-3-8-5(11)10(9-12)4-2-7/h1-4H2,(H,8,11) |
|
| InChIKey |
InChIKey=DLGOEMSEDOSKAD-UHFFFAOYSA-N |
|
| inhibits | ||
| is metabolised by | ||
| label |
carmustine |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_4551 http://purl.obolibrary.org/obo/CHEBI_8107 http://purl.obolibrary.org/obo/dinto_DB00108 http://purl.obolibrary.org/obo/CHEBI_61049 http://purl.obolibrary.org/obo/CHEBI_3699 http://purl.obolibrary.org/obo/CHEBI_47657 http://purl.obolibrary.org/obo/dinto_DB00072 http://purl.obolibrary.org/obo/dinto_DB01320 |
|
| prefixIRI |
obo2:CHEBI_3423 |
|
| prefLabel |
carmustine |
|
| related with | ||
| SMILES |
ClCCNC(=O)N(CCCl)N=O |
|
| Synonym |
Carmustine 1,3-bis(2-chloroethyl)-1-nitrosourea Gliadel C5H9Cl2N3O2 Bicnu (TN) N,N'-Bis(2-chloroethyl)-N-nitrosourea |
|
| xref |
DrugBank:DB00262 PharmGKB:PA448810 RxList:http://www.rxlist.com/cgi/generic3/carmustine.htm National Drug Code Directory:0015-3012-60 ChEMBL:110840 PubChem Compound:2578 ChemSpider:2480 Wikipedia:http://en.wikipedia.org/wiki/Carmustine CASRN:154-93-8 PubChem Substance:46506980 Drugs.com:http://www.drugs.com/cdi/carmustine.html KEGG DRUG:D00254 ChEBI:3423 Drugs Product Database (DPD):2238985 Wikipedia:Carmustine |
|
| subClassOf |