loading...| Preferred Name | crotamiton | |
| Synonyms |
crotamitone crotonyl-N-ethyl-o-toluidine N-ethyl-o-crotonotoluidide crotamiton N-ethyl-N-(2-methylphenyl)but-2-enamide crotamitonum crotalgin C13H17NO |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31439 |
|
| AHFScode |
84:04.12 |
|
| CASRN |
483-63-6 |
|
| DBBrand |
eurasil eurax cream crotamitex veteusan eurax lotion eurax crotan euraxil |
|
| DBname |
crotamiton |
|
| DBSynonym |
crotamitone crotaglin crotalgin |
|
| Definition |
The amide resulting from the formal condensation of crotonic acid with N-ethyl-2-methylaniline. A colourless or pale yellow oily liquid, it is used in the treatment of pruritus (itching) by producing a counter-irritation: as it evaporates from the skin, it produces a cooling effect that diverts attention away from the itching. It has also been used as an acaricide in the treatment of scabies, though more effective drugs are usually preferred. |
|
| has role | ||
| InChI |
InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3/b8-4+ InChI=1S/C13H17NO/c1-4-8-13(15)14(5-2)12-10-7-6-9-11(12)3/h4,6-10H,5H2,1-3H3 |
|
| InChIKey |
InChIKey=DNTGGZPQPQTDQF-XBXARRHUSA-N InChIKey=DNTGGZPQPQTDQF-UHFFFAOYSA-N |
|
| label |
crotamiton |
|
| prefixIRI |
obo2:CHEBI_31439 |
|
| prefLabel |
crotamiton |
|
| SMILES |
CCN(C(=O)C=CC)C1=CC=CC=C1C CCN(C(=O)C=CC)c1ccccc1C |
|
| Synonym |
crotamitone crotonyl-N-ethyl-o-toluidine N-ethyl-o-crotonotoluidide crotamiton N-ethyl-N-(2-methylphenyl)but-2-enamide crotamitonum crotalgin C13H17NO |
|
| xref |
CASRN:483-63-6 NIST Chemistry WebBook:483-63-6 Patent:GB615137 Beilstein:3275497 DrugBank:DB00265 RxList:http://www.rxlist.com/cgi/generic3/crotamiton.htm National Drug Code Directory:0072-2103-60 ChemSpider:2780 KEGG DRUG:D01381 PharmGKB:PA164745460 Drugs Product Database (DPD):623377 Drugs.com:http://www.drugs.com/cdi/crotamiton-cream.html Wikipedia:http://en.wikipedia.org/wiki/Crotamiton PubChem Compound:688020 PubChem Substance:46508599 |
|
| subClassOf |