Link to this page
The Drug-Drug Interactions Ontology
Last uploaded:
February 11, 2016
Jump to:
| Preferred Name | bethanechol chloride | |
| Synonyms |
2-((aminocarbonyl)oxy)-N,N,N-trimethyl-1-propanaminium chloride (2-hydroxypropyl)trimethylammonium chloride carbamate 2-carbamoyloxypropyltrimethylammonium chloride trimethyl(2-carbamoyloxypropyl)ammonium chloride 2-(carbamoyloxy)-N,N,N-trimethylpropan-1-aminium chloride C7H17ClN2O2 |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3085 |
|
| Definition |
The chloride salt of bethanechol. A slowly hydrolysed muscarinic agonist with no nicotinic effects, it is used to increase smooth muscle tone, as in the gastrointestinal tract following abdominal surgery, treatment of gastro-oesophageal reflux disease, and as an alternative to catheterisation in the treatment of non-obstructive urinary retention.
|
|
| has role | ||
| InChI |
InChI=1S/C7H16N2O2.ClH/c1-6(11-7(8)10)5-9(2,3)4;/h6H,5H2,1-4H3,(H-,8,10);1H
|
|
| InChIKey |
InChIKey=XXRMYXBSBOVVBH-UHFFFAOYSA-N
|
|
| label |
bethanechol chloride
|
|
| prefixIRI |
obo2:CHEBI_3085
|
|
| prefLabel |
bethanechol chloride
|
|
| SMILES |
[Cl-].CC(C[N+](C)(C)C)OC(N)=O
|
|
| Synonym |
2-((aminocarbonyl)oxy)-N,N,N-trimethyl-1-propanaminium chloride (2-hydroxypropyl)trimethylammonium chloride carbamate 2-carbamoyloxypropyltrimethylammonium chloride trimethyl(2-carbamoyloxypropyl)ammonium chloride 2-(carbamoyloxy)-N,N,N-trimethylpropan-1-aminium chloride C7H17ClN2O2
|
|
| xref |
KEGG DRUG:D01000 Patent:US2322375 CASRN:590-63-6 DrugBank:DB01019 Patent:US1894162 ChEMBL:694843 Wikipedia:Bethanechol Beilstein:3731819
|
|
| subClassOf |
Add comment
| Delete | Subject | Author | Type | Created |
|---|---|---|---|---|
| No notes to display |
Create mapping