Preferred Name |
trioxsalen |
|
Synonyms |
4,5',8-Trimethylpsoralen Trimethylpsoralen C14H12O3 trioxysalenum Trioxsalen trioxisaleno 4,8,5'-Trimethylpsoralen 2,5,9-trimethyl-7H-furo[3,2-g]chromen-7-one trioxysalen Trioxysalen 6-hydroxy-beta,2,7-trimethyl-5-benzofuranacrylic acid, delta-lactone 2',4,8-Trimethylpsoralen trioxysalene 4,7,9-trimethyl-2H-furo[3,2-g]chromen-2-one |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_28329 |
|
altId |
CHEBI:1758 CHEBI:20282 |
|
ATCCode |
D05AD01 |
|
binds | ||
CASRN |
3902-71-4 |
|
DBname |
trioxsalen |
|
DBSynonym |
trisoralen trimethylpsoralen trioxysalen |
|
Definition |
7H-Furo[3,2-g]chromen-7-one in which positions 2, 5, and 9 are substituted by methyl groups. Like other psoralens, trioxsalen causes photosensitization of the skin. It is administered orally in conjunction with UV-A for phototherapy treatment of vitiligo. After photoactivation it creates interstrand cross-links in DNA, inhibiting DNA synthesis and cell division, and can lead to cell injury; recovery from the cell injury may be followed by increased melanisation of the epidermis. |
|
has pharmacological target | ||
has role | ||
InChI |
InChI=1S/C14H12O3/c1-7-4-12(15)17-14-9(3)13-10(6-11(7)14)5-8(2)16-13/h4-6H,1-3H3 |
|
InChIKey |
InChIKey=FMHHVULEAZTJMA-UHFFFAOYSA-N |
|
label |
trioxsalen |
|
prefixIRI |
obo2:CHEBI_28329 |
|
prefLabel |
trioxsalen |
|
related with | ||
SMILES |
CC1=CC2=CC3=C(OC(=O)C=C3C)C(C)=C2O1 Cc1cc2cc3c(C)cc(=O)oc3c(C)c2o1 |
|
Synonym |
4,5',8-Trimethylpsoralen Trimethylpsoralen C14H12O3 trioxysalenum Trioxsalen trioxisaleno 4,8,5'-Trimethylpsoralen 2,5,9-trimethyl-7H-furo[3,2-g]chromen-7-one trioxysalen Trioxysalen 6-hydroxy-beta,2,7-trimethyl-5-benzofuranacrylic acid, delta-lactone 2',4,8-Trimethylpsoralen trioxysalene 4,7,9-trimethyl-2H-furo[3,2-g]chromen-2-one |
|
xref |
KEGG DRUG:D01034 KEGG COMPOUND:C09314 CASRN:3902-71-4 Wikipedia:Trioxsalen Beilstein:221723 NIST Chemistry WebBook:3902-71-4 DrugBank:DB04571 ChEMBL:502531 Patent:US3201421 Wikipedia:http://en.wikipedia.org/wiki/Trioxsalen PharmGKB:PA164747186 |
|
subClassOf |