Preferred Name |
acetophenone |
|
Synonyms |
C8H8O Methyl phenyl ketone Acetylbenzene benzoyl methide Phenyl methyl ketone 1-phenylethan-1-one 1-phenylethanone Acetophenone 1-Phenylethanone acetophenone |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27632 |
|
altId |
CHEBI:40490 CHEBI:22186 CHEBI:2403 |
|
DBname |
acetophenone |
|
Definition |
The ketone resulting from the oxidation of 1-phenylethanol. |
|
has role | ||
InChI |
InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
|
InChIKey |
InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N |
|
label |
acetophenone |
|
prefixIRI |
obo2:CHEBI_27632 |
|
prefLabel |
acetophenone |
|
related with | ||
SMILES |
CC(=O)c1ccccc1 CC(=O)C1=CC=CC=C1 |
|
Synonym |
C8H8O Methyl phenyl ketone Acetylbenzene benzoyl methide Phenyl methyl ketone 1-phenylethan-1-one 1-phenylethanone Acetophenone 1-Phenylethanone acetophenone |
|
xref |
KEGG COMPOUND:C07113 PDB:AC0 PubChem Compound:7410 ChEMBL:116741 ChEBI:c0117 ChEBI:27632 DrugBank:DB04619 CASRN:98-86-2 PubChem Substance:46507681 |
|
subClassOf |
Create mapping