loading...| Preferred Name | bromfenac | |
| Synonyms |
2-{2-amino-3-[(4-bromophenyl)carbonyl]phenyl}acetic acid 2-amino-3-(4-bromobenzoyl)benzeneacetic acid bromfenaco C15H12BrNO3 bromfenac bromfenacum [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid [2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_240107 |
|
| binds | ||
| CASRN |
91714-94-2 |
|
| DBBrand |
xibrom duract |
|
| DBname |
bromfenac |
|
| DBSynonym |
bromfenac sodium |
|
| Definition |
Amfenac in which the the hydrogen at the 4 position of the benzoyl group is substituted by bromine. It is used for the management of ocular pain and treatment of postoperative inflammation in patients who have undergone cataract extraction. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000377 http://purl.obolibrary.org/obo/OAE_0000373 |
|
| has pharmacological target | ||
| has role | ||
| InChI |
InChI=1S/C15H12BrNO3/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19/h1-7H,8,17H2,(H,18,19) |
|
| InChIKey |
InChIKey=ZBPLOVFIXSTCRZ-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
bromfenac |
|
| may interact with | ||
| prefixIRI |
obo2:CHEBI_240107 |
|
| prefLabel |
bromfenac |
|
| SMILES |
NC1=C(CC(O)=O)C=CC=C1C(=O)C1=CC=C(Br)C=C1 Nc1c(CC(O)=O)cccc1C(=O)c1ccc(Br)cc1 |
|
| Synonym |
2-{2-amino-3-[(4-bromophenyl)carbonyl]phenyl}acetic acid 2-amino-3-(4-bromobenzoyl)benzeneacetic acid bromfenaco C15H12BrNO3 bromfenac bromfenacum [2-Amino-3-(4-bromo-benzoyl)-phenyl]-acetic acid [2-amino-3-(4-bromobenzoyl)phenyl]acetic acid |
|
| xref |
PharmGKB:PA448670 RxList:http://www.rxlist.com/cgi/generic4/xibrom.htm PubChem Substance:46508121 Wikipedia:Bromfenac DrugBank:DB00963 KEGG DRUG:D07541 Drugs.com:http://www.drugs.com/cdi/bromfenac.html Patent:US4683242 CASRN:91714-94-2 Patent:EP221753 Beilstein:8335547 PubChem Compound:60726 National Drug Code Directory:67425-004-50 ChEBI:240107 ChemSpider:54730 |
|
| subClassOf |