Preferred Name |
fosamprenavir |
|
Synonyms |
(3S)-tetrahydrofuran-3-yl [(2S,3R)-4-{[(4-aminophenyl)sulfonyl](2-methylpropyl)amino}-1-phenyl-3-(phosphonooxy)butan-2-yl]carbamate fosamprenavir FOS-APV |
|
Definitions |
A sulfonamide with a structure based on that of sulfanilamide substituted on the sulfonamide nitrogen by a (2R,3S)-4-phenyl-2-(phosphonooxy)-3-({[(3S)-tetrahydrofuran-3-yloxy]carbonyl}amino)butyl group. It is a pro-drug of the HIV protease inhibitor and antiretroviral drug amprenavir. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_82941 |
|
alternative_term |
(3S)-tetrahydrofuran-3-yl [(2S,3R)-4-{[(4-aminophenyl)sulfonyl](2-methylpropyl)amino}-1-phenyl-3-(phosphonooxy)butan-2-yl]carbamate |
|
charge |
0 |
|
database_cross_reference |
PMID:22100576 PMID:25155604 PMID:24929949 KEGG:D02497 CAS:226700-79-4 HMDB:HMDB0015416 PMID:25017682 PMID:23314414 PMID:24741696 Reaxys:9824450 DrugBank:DB01319 Drug_Central:1240 PMID:16890834 PMID:23811744 Wikipedia:Fosamprenavir |
|
formula |
C25H36N3O9PS |
|
fromPubMed |
true |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
fosamprenavir FOS-APV |
|
id |
CHEBI:82941 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C25H36N3O9PS/c1-18(2)15-28(39(33,34)22-10-8-20(26)9-11-22)16-24(37-38(30,31)32)23(14-19-6-4-3-5-7-19)27-25(29)36-21-12-13-35-17-21/h3-11,18,21,23-24H,12-17,26H2,1-2H3,(H,27,29)(H2,30,31,32)/t21-,23-,24+/m0/s1 |
|
inchikey |
MLBVMOWEQCZNCC-OEMFJLHTSA-N |
|
label |
fosamprenavir |
|
mass |
585.60700 |
|
monoisotopicmass |
585.19099 |
|
notation |
CHEBI:82941 |
|
oboInOwl:hasDbXRef | ||
prefLabel |
fosamprenavir |
|
smiles |
CC(C)CN(C[C@@H](OP(O)(O)=O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
|
textual definition |
A sulfonamide with a structure based on that of sulfanilamide substituted on the sulfonamide nitrogen by a (2R,3S)-4-phenyl-2-(phosphonooxy)-3-({[(3S)-tetrahydrofuran-3-yloxy]carbonyl}amino)butyl group. It is a pro-drug of the HIV protease inhibitor and antiretroviral drug amprenavir. |
|
subClassOf |