loading...| Preferred Name |
oxymetholone |
|
| Synonyms |
2-hydroxymethylene-17alpha-methyl-5alpha-androstan-17beta-ol-3-one (5alpha,17beta)-17-hydroxy-2-(hydroxymethylidene)-17-methylandrostan-3-one 2-hydroxymethylene-17alpha-methyl-17beta-hydroxy-5alpha-androstan-3-one oxymetholone oxymetholonum 2-hydroxymethylene-17alpha-methyldihydrotestosterone 17alpha-methyl-2-hydroxymethylene-17-hydroxy-5alpha-androstan-3-one 4,5alpha-dihydro-2-hydroxymethylene-17alpha-methyltestosterone oximetolona 17beta-hydroxy-2-(hydroxymethylene)-17-methyl-5alpha-androstan-3-one Adroyd Anadrol-50 Anapolon Nastenon Pardroyd Plenastril Protanabol Synasteron 17beta-hydroxy-2-(hydroxymethylidene)-17-methyl-5alpha-androstan-3-one |
|
| Definitions |
A 3-oxo-5alpha- steroid that is 4,5alpha-dihydrotestosterone which is substituted by a hydroxymethylidene group at position 2 and by a methyl group at the 17alpha position. A synthetic androgen, it was mainly used for the treatment of anaemias until being replaced by treatments with fewer side effects. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_7864 |
|
| alternative_term |
17beta-hydroxy-2-(hydroxymethylidene)-17-methyl-5alpha-androstan-3-one |
|
| charge |
0 |
|
| database_cross_reference |
PMID:1125426 Patent:DE1070632 PMID:11071398 CAS:434-07-1 PMID:21860526 KEGG:C07393 Reaxys:2623806 KEGG:D00490 Wikipedia:Oxymetholone PMID:11440282 |
|
| definition |
A 3-oxo-5alpha- steroid that is 4,5alpha-dihydrotestosterone which is substituted by a hydroxymethylidene group at position 2 and by a methyl group at the 17alpha position. A synthetic androgen, it was mainly used for the treatment of anaemias until being replaced by treatments with fewer side effects. |
|
| formula |
C21H32O3 |
|
| fromPubMed |
true |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-hydroxymethylene-17alpha-methyl-5alpha-androstan-17beta-ol-3-one (5alpha,17beta)-17-hydroxy-2-(hydroxymethylidene)-17-methylandrostan-3-one 2-hydroxymethylene-17alpha-methyl-17beta-hydroxy-5alpha-androstan-3-one oxymetholone oxymetholonum 2-hydroxymethylene-17alpha-methyldihydrotestosterone 17alpha-methyl-2-hydroxymethylene-17-hydroxy-5alpha-androstan-3-one 4,5alpha-dihydro-2-hydroxymethylene-17alpha-methyltestosterone oximetolona 17beta-hydroxy-2-(hydroxymethylene)-17-methyl-5alpha-androstan-3-one Adroyd Anadrol-50 Anapolon Nastenon Pardroyd Plenastril Protanabol Synasteron |
|
| id |
CHEBI:7864 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C21H32O3/c1-19-11-13(12-22)18(23)10-14(19)4-5-15-16(19)6-8-20(2)17(15)7-9-21(20,3)24/h12,14-17,22,24H,4-11H2,1-3H3/t14-,15+,16-,17-,19-,20-,21-/m0/s1 |
|
| inchikey |
ICMWWNHDUZJFDW-IYRCEVNGSA-N |
|
| label |
oxymetholone |
|
| mass |
332.47700 |
|
| monoisotopicmass |
332.23514 |
|
| notation |
CHEBI:7864 |
|
| oboInOwl:hasDbXRef | ||
| preferred label |
oxymetholone |
|
| prefLabel |
oxymetholone |
|
| smiles |
C[C@]1(O)CC[C@H]2[C@@H]3CC[C@H]4CC(=O)C(C[C@]4(C)[C@H]3CC[C@]12C)=CO |
|
| textual definition |
A 3-oxo-5alpha- steroid that is 4,5alpha-dihydrotestosterone which is substituted by a hydroxymethylidene group at position 2 and by a methyl group at the 17alpha position. A synthetic androgen, it was mainly used for the treatment of anaemias until being replaced by treatments with fewer side effects. |
|
| subClassOf |