loading...| Preferred Name | nitrofurantoin | |
| Synonyms |
nitrofurantoin nitrofurantoina nitrofurantoine 1-((5-Nitrofurfurylidene)amino)hydantoin 1-[(5-Nitrofurfurylidene)amino]hydantoin 1-(5-Nitro-2-furfurylidenamino)hydantoin 1-(5-Nitro-2-furfurylideneamino)hydantoin nitrofurantoinum 5-Nitrofurantoin N-(5-Nitrofurfurylidene)-1-aminohydantoin 1-{[(5-nitro-2-furyl)methylene]amino}imidazolidine-2,4-dione |
|
| Definitions |
An imidazolidine-2,4-dione that is hydantoin substituted at position 1 by a [(5-nitro-2-furyl)methylene]amino group. An antibiotic that damages bacterial DNA. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_71415 |
|
| alternative_term |
1-{[(5-nitro-2-furyl)methylene]amino}imidazolidine-2,4-dione |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22252772 PMID:22252808 PMID:22285235 PMID:22787489 KEGG:C07268 Wikipedia:Nitrofurantoin PMID:23114172 Patent:US2927110 PMID:22535452 PMID:22332195 Reaxys:8132135 PMID:22876623 PMID:22869929 PMID:23109011 PMID:22977056 DrugBank:DB00698 PMID:22929632 PMID:22836745 PMID:22779302 PMID:22857139 PMID:22552451 CAS:67-20-9 PMID:22508296 Patent:US2610181 PMID:22240115 Patent:WO2006019844 PMID:22923965 PMID:21567157 PMID:22722224 PMID:23113731 Drug_Central:1949 KEGG:D00439 Patent:US2898335 Patent:WO2008103673 Patent:WO2010065110 PMID:23016316 |
|
| definition |
An imidazolidine-2,4-dione that is hydantoin substituted at position 1 by a [(5-nitro-2-furyl)methylene]amino group. An antibiotic that damages bacterial DNA. |
|
| formula |
C8H6N4O5 |
|
| fromPubMed |
true |
|
| has_alternative_id |
CHEBI:7591 |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
nitrofurantoin nitrofurantoina nitrofurantoine 1-((5-Nitrofurfurylidene)amino)hydantoin 1-[(5-Nitrofurfurylidene)amino]hydantoin 1-(5-Nitro-2-furfurylidenamino)hydantoin 1-(5-Nitro-2-furfurylideneamino)hydantoin nitrofurantoinum 5-Nitrofurantoin N-(5-Nitrofurfurylidene)-1-aminohydantoin |
|
| id |
CHEBI:71415 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ |
|
| inchikey |
NXFQHRVNIOXGAQ-YCRREMRBSA-N |
|
| label |
nitrofurantoin |
|
| mass |
238.157 |
|
| monoisotopicmass |
238.03382 |
|
| notation |
CHEBI:71415 |
|
| oboInOwl:hasDbXRef | ||
| preferred label |
nitrofurantoin |
|
| prefLabel |
nitrofurantoin |
|
| smiles |
C1(N(/N=C/C=2OC(=CC2)[N+]([O-])=O)CC(N1)=O)=O |
|
| textual definition |
An imidazolidine-2,4-dione that is hydantoin substituted at position 1 by a [(5-nitro-2-furyl)methylene]amino group. An antibiotic that damages bacterial DNA. |
|
| subClassOf |