Preferred Name |
labetalol |
|
Synonyms |
2-hydroxy-5-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]ethyl}benzamide Labetalol 3-Carboxamido-4-hydroxy-alpha-((1-methyl-3-phenylpropylamino)methyl)benzyl alcohol 5-(1-Hydroxy-2-(1-methyl-3-phenylpropylamino)ethyl)salicylamide labetalolum kabetalol labetalol |
|
Definitions |
A secondary amino compound formally derived from ammonia by replacing two of the hydrogens by 2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl and 4-phenylbutan-2-yl groups. It is an adrenergic antagonist used to treat high blood pressure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6343 |
|
alternative_term |
2-hydroxy-5-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]ethyl}benzamide Labetalol |
|
charge |
0 |
|
database_cross_reference |
Patent:DE2032642 LINCS:LSM-1282 KEGG:D08106 Reaxys:2948416 Drug_Central:1531 CAS:36894-69-6 Beilstein:2948416 PMID:21908132 PMID:22528277 Patent:US4012444 Wikipedia:Labetalol KEGG:C07063 HMDB:HMDB0014736 PMID:28166217 PMID:23055089 PMID:22300487 DrugBank:DB00598 |
|
formula |
C19H24N2O3 |
|
fromArticle |
true |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
3-Carboxamido-4-hydroxy-alpha-((1-methyl-3-phenylpropylamino)methyl)benzyl alcohol 5-(1-Hydroxy-2-(1-methyl-3-phenylpropylamino)ethyl)salicylamide labetalolum kabetalol labetalol |
|
id |
CHEBI:6343 |
|
imported from | ||
in_subset | ||
inchi |
InChI=1S/C19H24N2O3/c1-13(7-8-14-5-3-2-4-6-14)21-12-18(23)15-9-10-17(22)16(11-15)19(20)24/h2-6,9-11,13,18,21-23H,7-8,12H2,1H3,(H2,20,24) |
|
inchikey |
SGUAFYQXFOLMHL-UHFFFAOYSA-N |
|
label |
labetalol |
|
mass |
328.40554 |
|
monoisotopicmass |
328.17869 |
|
notation |
CHEBI:6343 |
|
prefLabel |
labetalol |
|
see also | ||
smiles |
CC(CCc1ccccc1)NCC(O)c1ccc(O)c(c1)C(N)=O |
|
textual definition |
A secondary amino compound formally derived from ammonia by replacing two of the hydrogens by 2-(3-carbamoyl-4-hydroxyphenyl)-2-hydroxyethyl and 4-phenylbutan-2-yl groups. It is an adrenergic antagonist used to treat high blood pressure. |
|
subClassOf |