loading...| Preferred Name | chloroquine | |
| Synonyms |
chloroquinum Nivaquine B N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine chloroquine Aralen Artrichin Bemaphate Capquin Chlorochin Resoquine Reumachlor Sanoquin cloroquina Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine |
|
| Definitions |
An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3638 |
|
| alternative_term |
Chloroquine N(4)-(7-chloroquinolin-4-yl)-N(1),N(1)-diethylpentane-1,4-diamine |
|
| charge |
0 |
|
| database_cross_reference |
Patent:DE683692 PMID:18052874 Beilstein:482809 LINCS:LSM-1901 PMID:19426658 PDBeChem:CLQ Wikipedia:Chloroquine PMID:17594118 PMID:23580861 Patent:US2233970 CAS:54-05-7 KEGG:D02366 PMID:23644906 PMID:23706562 PMID:23891850 PMID:23635029 Drug_Central:607 PMID:23852712 DrugBank:DB00608 HMDB:HMDB0014746 Reaxys:482809 PMID:23288916 KEGG:C07625 PMID:11198399 Gmelin:781126 PMID:25285162 |
|
| definition |
An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
| formula |
C18H26ClN3 |
|
| fromPubMed |
true |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
chloroquinum Nivaquine B N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine chloroquine Aralen Artrichin Bemaphate Capquin Chlorochin Resoquine Reumachlor Sanoquin cloroquina |
|
| id |
CHEBI:3638 |
|
| imported from | ||
| in_subset | ||
| inchi |
InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) |
|
| inchikey |
WHTVZRBIWZFKQO-UHFFFAOYSA-N |
|
| label |
chloroquine |
|
| mass |
319.87200 |
|
| monoisotopicmass |
319.18153 |
|
| notation |
CHEBI:3638 |
|
| oboInOwl:hasDbXRef | ||
| preferred label |
chloroquine |
|
| prefLabel |
chloroquine |
|
| smiles |
CCN(CC)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
|
| textual definition |
An aminoquinoline that is quinoline which is substituted at position 4 by a [5-(diethylamino)pentan-2-yl]amino group at at position 7 by chlorine. It is used for the treatment of malaria, hepatic amoebiasis, lupus erythematosus, light-sensitive skin eruptions, and rheumatoid arthritis. |
|
| subClassOf |